![]() |
Name |
Endostemonine D
|
Molecular Formula | C13H18N2O5 | |
IUPAC Name* |
5-(4-acetamido-1H-pyrrole-2-carbonyl)oxyhexanoicacid
|
|
SMILES |
CC(=O)Nc1c[nH]c(C(=O)OC(C)CCCC(=O)O)c1
|
|
InChI |
InChI=1S/C13H18N2O5/c1-8(4-3-5-12(17)18)20-13(19)11-6-10(7-14-11)15-9(2)16/h6-8,14H,3-5H2,1-2H3,(H,15,16)(H,17,18)/t8-/m1/s1
|
|
InChIKey |
HAXKVNILDCVXBJ-MRVPVSSYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 282.3 | ALogp: | 1.8 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 108.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.665 |
Caco-2 Permeability: | -5.361 | MDCK Permeability: | 0.00000963 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.077 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.93 |
Blood-Brain-Barrier Penetration (BBB): | 0.382 | Plasma Protein Binding (PPB): | 28.40% |
Volume Distribution (VD): | 0.24 | Fu: | 64.25% |
CYP1A2-inhibitor: | 0.054 | CYP1A2-substrate: | 0.106 |
CYP2C19-inhibitor: | 0.044 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.936 |
CYP2D6-inhibitor: | 0.055 | CYP2D6-substrate: | 0.184 |
CYP3A4-inhibitor: | 0.022 | CYP3A4-substrate: | 0.06 |
Clearance (CL): | 5.425 | Half-life (T1/2): | 0.933 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.1 |
Drug-inuced Liver Injury (DILI): | 0.714 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.475 |
Skin Sensitization: | 0.11 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.175 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005086 | ![]() |
0.869 | D02AQY | ![]() |
0.314 | ||
ENC005081 | ![]() |
0.695 | D0Z0MG | ![]() |
0.279 | ||
ENC005085 | ![]() |
0.606 | D0HD9K | ![]() |
0.266 | ||
ENC005079 | ![]() |
0.556 | D0KD1U | ![]() |
0.262 | ||
ENC005077 | ![]() |
0.492 | D07WXE | ![]() |
0.260 | ||
ENC005084 | ![]() |
0.486 | D08GJO | ![]() |
0.255 | ||
ENC005082 | ![]() |
0.457 | D01KKQ | ![]() |
0.246 | ||
ENC005078 | ![]() |
0.373 | D07SJT | ![]() |
0.243 | ||
ENC005083 | ![]() |
0.351 | D06LHU | ![]() |
0.241 | ||
ENC004268 | ![]() |
0.326 | D0Y4GO | ![]() |
0.239 |