![]() |
Name |
bipolatoxin D
|
Molecular Formula | C25H38O4 | |
IUPAC Name* |
15-hydroxy-6-(6-hydroxy-6-methylhept-4-en-2-yl)-3,15-dimethyl-12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-en-11-one
|
|
SMILES |
CC(CC=CC(C)(C)O)C1CCC2(C)CC3C4C(=CCC12)C(=O)OC4CC3(C)O
|
|
InChI |
InChI=1S/C25H38O4/c1-15(7-6-11-23(2,3)27)16-10-12-24(4)13-19-21-17(8-9-18(16)24)22(26)29-20(21)14-25(19,5)28/h6,8,11,15-16,18-21,27-28H,7,9-10,12-14H2,1-5H3/b11-6+,17-8+/t15-,16+,18-,19-,20-,21+,24+,25+/m0/s1
|
|
InChIKey |
XHGDEMICZQMLLB-PFKJMYAGSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 402.58 | ALogp: | 4.4 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.517 |
Caco-2 Permeability: | -4.659 | MDCK Permeability: | 0.00001460 |
Pgp-inhibitor: | 0.956 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.04 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.243 |
Blood-Brain-Barrier Penetration (BBB): | 0.294 | Plasma Protein Binding (PPB): | 96.50% |
Volume Distribution (VD): | 0.948 | Fu: | 4.01% |
CYP1A2-inhibitor: | 0.027 | CYP1A2-substrate: | 0.34 |
CYP2C19-inhibitor: | 0.139 | CYP2C19-substrate: | 0.853 |
CYP2C9-inhibitor: | 0.285 | CYP2C9-substrate: | 0.729 |
CYP2D6-inhibitor: | 0.034 | CYP2D6-substrate: | 0.334 |
CYP3A4-inhibitor: | 0.69 | CYP3A4-substrate: | 0.555 |
Clearance (CL): | 11.611 | Half-life (T1/2): | 0.075 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.261 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.295 | Maximum Recommended Daily Dose: | 0.943 |
Skin Sensitization: | 0.521 | Carcinogencity: | 0.357 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
Respiratory Toxicity: | 0.133 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005044 | ![]() |
0.550 | D0Y7LD | ![]() |
0.246 | ||
ENC003209 | ![]() |
0.472 | D08IWD | ![]() |
0.244 | ||
ENC005045 | ![]() |
0.463 | D0K0EK | ![]() |
0.243 | ||
ENC005050 | ![]() |
0.463 | D0L2LS | ![]() |
0.241 | ||
ENC002983 | ![]() |
0.463 | D0Q6NZ | ![]() |
0.239 | ||
ENC003687 | ![]() |
0.446 | D0T2PL | ![]() |
0.238 | ||
ENC002000 | ![]() |
0.409 | D0W5LS | ![]() |
0.238 | ||
ENC003783 | ![]() |
0.409 | D0P0HT | ![]() |
0.238 | ||
ENC002981 | ![]() |
0.377 | D0G6AB | ![]() |
0.237 | ||
ENC003777 | ![]() |
0.356 | D08PIQ | ![]() |
0.236 |