|
Name |
botryospyrone D
|
| Molecular Formula | C13H16O5 | |
| IUPAC Name* |
4-hydroxy-6,8-dimethoxy-3,7-dimethyl-3,4-dihydroisochromen-1-one
|
|
| SMILES |
COc1cc2c(c(OC)c1C)C(=O)OC(C)C2O
|
|
| InChI |
InChI=1S/C13H16O5/c1-6-9(16-3)5-8-10(12(6)17-4)13(15)18-7(2)11(8)14/h5,7,11,14H,1-4H3/t7-,11-/m0/s1
|
|
| InChIKey |
VNZFGBOMNXGPEV-CPCISQLKSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 252.27 | ALogp: | 1.6 |
| HBD: | 1 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 65.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 18 | QED Weighted: | 0.817 |
| Caco-2 Permeability: | -4.726 | MDCK Permeability: | 0.00002170 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.013 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.007 |
| Blood-Brain-Barrier Penetration (BBB): | 0.965 | Plasma Protein Binding (PPB): | 63.14% |
| Volume Distribution (VD): | 0.746 | Fu: | 20.23% |
| CYP1A2-inhibitor: | 0.354 | CYP1A2-substrate: | 0.954 |
| CYP2C19-inhibitor: | 0.07 | CYP2C19-substrate: | 0.903 |
| CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.818 |
| CYP2D6-inhibitor: | 0.031 | CYP2D6-substrate: | 0.723 |
| CYP3A4-inhibitor: | 0.056 | CYP3A4-substrate: | 0.524 |
| Clearance (CL): | 7.077 | Half-life (T1/2): | 0.5 |
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.193 |
| Drug-inuced Liver Injury (DILI): | 0.323 | AMES Toxicity: | 0.067 |
| Rat Oral Acute Toxicity: | 0.098 | Maximum Recommended Daily Dose: | 0.024 |
| Skin Sensitization: | 0.055 | Carcinogencity: | 0.028 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.065 |
| Respiratory Toxicity: | 0.065 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005163 | ![]() |
0.750 | D0L1JW | ![]() |
0.333 | ||
| ENC005556 | ![]() |
0.745 | D04TDQ | ![]() |
0.330 | ||
| ENC005907 | ![]() |
0.684 | D0C1SF | ![]() |
0.299 | ||
| ENC004991 | ![]() |
0.525 | D0G4KG | ![]() |
0.295 | ||
| ENC002669 | ![]() |
0.517 | D0D4HN | ![]() |
0.291 | ||
| ENC004498 | ![]() |
0.453 | D09PJX | ![]() |
0.287 | ||
| ENC004363 | ![]() |
0.452 | D02LZB | ![]() |
0.281 | ||
| ENC003612 | ![]() |
0.434 | D06GCK | ![]() |
0.272 | ||
| ENC000799 | ![]() |
0.434 | D09DHY | ![]() |
0.267 | ||
| ENC003801 | ![]() |
0.434 | D0F7CS | ![]() |
0.262 | ||