![]() |
Name |
3,5-dihydroxy-2-methyl-4H-chromen-4-one
|
Molecular Formula | C10H8O4 | |
IUPAC Name* |
3,5-dihydroxy-2-methylchromen-4-one
|
|
SMILES |
Cc1oc2cccc(O)c2c(=O)c1O
|
|
InChI |
InChI=1S/C10H8O4/c1-5-9(12)10(13)8-6(11)3-2-4-7(8)14-5/h2-4,11-12H,1H3
|
|
InChIKey |
AHUXDLHAOVQXCH-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.17 | ALogp: | 1.5 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 70.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.67 |
Caco-2 Permeability: | -4.803 | MDCK Permeability: | 0.00001490 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.05 |
Blood-Brain-Barrier Penetration (BBB): | 0.032 | Plasma Protein Binding (PPB): | 91.81% |
Volume Distribution (VD): | 0.625 | Fu: | 12.69% |
CYP1A2-inhibitor: | 0.903 | CYP1A2-substrate: | 0.891 |
CYP2C19-inhibitor: | 0.134 | CYP2C19-substrate: | 0.156 |
CYP2C9-inhibitor: | 0.317 | CYP2C9-substrate: | 0.832 |
CYP2D6-inhibitor: | 0.448 | CYP2D6-substrate: | 0.361 |
CYP3A4-inhibitor: | 0.134 | CYP3A4-substrate: | 0.205 |
Clearance (CL): | 3.863 | Half-life (T1/2): | 0.852 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.093 |
Drug-inuced Liver Injury (DILI): | 0.776 | AMES Toxicity: | 0.546 |
Rat Oral Acute Toxicity: | 0.254 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.76 | Carcinogencity: | 0.423 |
Eye Corrosion: | 0.577 | Eye Irritation: | 0.973 |
Respiratory Toxicity: | 0.173 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001447 | ![]() |
0.574 | D0K8KX | ![]() |
0.361 | ||
ENC004887 | ![]() |
0.571 | D04AIT | ![]() |
0.297 | ||
ENC004883 | ![]() |
0.571 | D0QV5T | ![]() |
0.289 | ||
ENC002671 | ![]() |
0.537 | D06GCK | ![]() |
0.289 | ||
ENC002284 | ![]() |
0.477 | D0Y7PG | ![]() |
0.278 | ||
ENC004886 | ![]() |
0.477 | D07HBX | ![]() |
0.275 | ||
ENC005347 | ![]() |
0.453 | D0E3OF | ![]() |
0.272 | ||
ENC004138 | ![]() |
0.449 | D0Z3DY | ![]() |
0.269 | ||
ENC005904 | ![]() |
0.446 | D02TJS | ![]() |
0.267 | ||
ENC002283 | ![]() |
0.446 | D0H6QU | ![]() |
0.267 |