|
Name |
4-hydroxy-2-nonyl-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzoic acid
|
| Molecular Formula | C24H42O8 | |
| IUPAC Name* |
4-hydroxy-6-nonyl-2-[[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxymethyl]cyclohexene-1-carboxylicacid
|
|
| SMILES |
CCCCCCCCCC1CC(O)CC(COC2CC(CO)C(O)C(O)C2O)=C1C(=O)O
|
|
| InChI |
InChI=1S/C24H42O8/c1-2-3-4-5-6-7-8-9-15-10-18(26)11-17(20(15)24(30)31)14-32-19-12-16(13-25)21(27)23(29)22(19)28/h15-16,18-19,21-23,25-29H,2-14H2,1H3,(H,30,31)/t15-,16-,18+,19-,21+,22-,23+/m1/s1
|
|
| InChIKey |
HFWLUDJYSUZRIE-KGLKZMTNSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 458.59 | ALogp: | 1.8 |
| HBD: | 6 | HBA: | 7 |
| Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 147.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 32 | QED Weighted: | 0.231 |
| Caco-2 Permeability: | -5.429 | MDCK Permeability: | 0.00017117 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.027 |
| Human Intestinal Absorption (HIA): | 0.969 | 20% Bioavailability (F20%): | 0.975 |
| 30% Bioavailability (F30%): | 0.995 |
| Blood-Brain-Barrier Penetration (BBB): | 0.199 | Plasma Protein Binding (PPB): | 82.72% |
| Volume Distribution (VD): | 0.539 | Fu: | 9.72% |
| CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.081 |
| CYP2C19-inhibitor: | 0.006 | CYP2C19-substrate: | 0.314 |
| CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.945 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.097 |
| CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.014 |
| Clearance (CL): | 1.514 | Half-life (T1/2): | 0.527 |
| hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.137 |
| Drug-inuced Liver Injury (DILI): | 0.965 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.671 | Maximum Recommended Daily Dose: | 0.104 |
| Skin Sensitization: | 0.033 | Carcinogencity: | 0.25 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.479 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005852 | ![]() |
0.356 | D0XN8C | ![]() |
0.361 | ||
| ENC004171 | ![]() |
0.354 | D0I4DQ | ![]() |
0.331 | ||
| ENC004172 | ![]() |
0.354 | D03JSJ | ![]() |
0.305 | ||
| ENC002066 | ![]() |
0.353 | D09SRR | ![]() |
0.304 | ||
| ENC005599 | ![]() |
0.343 | D00CTS | ![]() |
0.286 | ||
| ENC004173 | ![]() |
0.333 | D09ANG | ![]() |
0.286 | ||
| ENC003174 | ![]() |
0.320 | D0H2YX | ![]() |
0.276 | ||
| ENC002302 | ![]() |
0.316 | D00STJ | ![]() |
0.270 | ||
| ENC001227 | ![]() |
0.313 | D03ZJE | ![]() |
0.267 | ||
| ENC004781 | ![]() |
0.311 | D01WUA | ![]() |
0.265 | ||