NPs Basic Information
|
Name |
4-O-methylpestalactam A
|
| Molecular Formula | C11H14ClNO4 | |
| IUPAC Name* |
3-chloro-7-(2-hydroxy-2-methylpropyl)-4-methoxy-1H-azepine-2,5-dione
|
|
| SMILES |
COc1c(Cl)c(=O)[nH]c(CC(C)(C)O)cc1=O
|
|
| InChI |
InChI=1S/C11H14ClNO4/c1-11(2,16)5-6-4-7(14)9(17-3)8(12)10(15)13-6/h4,16H,5H2,1-3H3,(H,13,15)
|
|
| InChIKey |
PIIGXIKFMIZGIW-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 259.69 | ALogp: | 0.7 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 79.4 | Aromatic Rings: | 1 |
| Heavy Atoms: | 17 | QED Weighted: | 0.852 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.665 | MDCK Permeability: | 0.00001350 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.093 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.003 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.152 | Plasma Protein Binding (PPB): | 47.45% |
| Volume Distribution (VD): | 0.488 | Fu: | 29.59% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.172 | CYP1A2-substrate: | 0.775 |
| CYP2C19-inhibitor: | 0.28 | CYP2C19-substrate: | 0.264 |
| CYP2C9-inhibitor: | 0.081 | CYP2C9-substrate: | 0.835 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.235 |
| CYP3A4-inhibitor: | 0.029 | CYP3A4-substrate: | 0.177 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.661 | Half-life (T1/2): | 0.74 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.25 |
| Drug-inuced Liver Injury (DILI): | 0.764 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.027 |
| Skin Sensitization: | 0.086 | Carcinogencity: | 0.027 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.031 |
| Respiratory Toxicity: | 0.039 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004720 |  |
0.725 | D0G4KG |  |
0.228 | ||
| ENC002824 |  |
0.700 | D0C1SF |  |
0.225 | ||
| ENC002825 |  |
0.509 | D07MEH |  |
0.224 | ||
| ENC003436 |  |
0.456 | D0X5NX |  |
0.222 | ||
| ENC002826 |  |
0.361 | D04UTT |  |
0.220 | ||
| ENC003235 |  |
0.352 | D0T4WA |  |
0.217 | ||
| ENC004719 |  |
0.306 | D0I0DS |  |
0.215 | ||
| ENC003935 |  |
0.299 | D0O6KE |  |
0.211 | ||
| ENC002456 |  |
0.293 | D01XNB |  |
0.207 | ||
| ENC005700 |  |
0.292 | D0C6DT |  |
0.207 | ||