![]() |
Name |
Cyophiobiolin C
|
Molecular Formula | C27H38O4 | |
IUPAC Name* |
[6-(3,15-dimethyl-11-oxo-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-5,9-dien-6-yl)-2-methylhept-2-enyl]acetate
|
|
SMILES |
CC(=O)OCC(C)=CCCC(C)C1=CCC2(C)CC3C(C)CC4OC(=O)C(=CCC12)C43
|
|
InChI |
InChI=1S/C27H38O4/c1-16(15-30-19(4)28)7-6-8-17(2)20-11-12-27(5)14-22-18(3)13-24-25(22)21(26(29)31-24)9-10-23(20)27/h7,9,11,17-18,22-25H,6,8,10,12-15H2,1-5H3/b16-7-,21-9+/t17-,18+,22+,23+,24-,25+,27-/m1/s1
|
|
InChIKey |
WCVGJQNTSQQMGT-KYTBOKHNSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 426.6 | ALogp: | 5.8 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 52.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.392 |
Caco-2 Permeability: | -4.629 | MDCK Permeability: | 0.00001390 |
Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.602 | 20% Bioavailability (F20%): | 0.314 |
30% Bioavailability (F30%): | 0.801 |
Blood-Brain-Barrier Penetration (BBB): | 0.427 | Plasma Protein Binding (PPB): | 98.08% |
Volume Distribution (VD): | 2.611 | Fu: | 2.85% |
CYP1A2-inhibitor: | 0.076 | CYP1A2-substrate: | 0.117 |
CYP2C19-inhibitor: | 0.336 | CYP2C19-substrate: | 0.569 |
CYP2C9-inhibitor: | 0.417 | CYP2C9-substrate: | 0.176 |
CYP2D6-inhibitor: | 0.13 | CYP2D6-substrate: | 0.109 |
CYP3A4-inhibitor: | 0.891 | CYP3A4-substrate: | 0.596 |
Clearance (CL): | 13.31 | Half-life (T1/2): | 0.019 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.156 |
Drug-inuced Liver Injury (DILI): | 0.661 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.419 | Maximum Recommended Daily Dose: | 0.916 |
Skin Sensitization: | 0.119 | Carcinogencity: | 0.763 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.961 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004491 | ![]() |
0.523 | D09WYX | ![]() |
0.289 | ||
ENC005050 | ![]() |
0.473 | D0G7KJ | ![]() |
0.261 | ||
ENC004488 | ![]() |
0.440 | D08BDT | ![]() |
0.252 | ||
ENC004489 | ![]() |
0.405 | D03ZZK | ![]() |
0.250 | ||
ENC001869 | ![]() |
0.360 | D01ZOG | ![]() |
0.245 | ||
ENC001868 | ![]() |
0.360 | D02CNR | ![]() |
0.244 | ||
ENC005805 | ![]() |
0.360 | D0V2JK | ![]() |
0.240 | ||
ENC005806 | ![]() |
0.353 | D06WTZ | ![]() |
0.239 | ||
ENC005807 | ![]() |
0.336 | D02CJX | ![]() |
0.238 | ||
ENC004443 | ![]() |
0.336 | D0X7XG | ![]() |
0.233 |