|
Name |
Zelkovamycin B
|
| Molecular Formula | C36H43N9O10S | |
| IUPAC Name* |
(1S,4S,11R,17Z,20R,25S)-20-ethyl-17-ethylidene-25-hydroxy-4-[(4-methoxy-1H-indol-3-yl)methyl]-1,11,15-trimethyl-9-thia-2,5,12,15,18,21,24,28-octazatricyclo[22.2.1.17,10]octacosa-7,10(28)-diene-3,6,13,16,19,22,26,27-octone
|
|
| SMILES |
CC[C@@H]1C(=O)N/C(=C\C)/C(=O)N(CC(=O)N[C@@H](C2=NC(=CS2)C(=O)N[C@H](C(=O)N[C@]3(C(=O)[C@@H](N(C3=O)CC(=O)N1)O)C)CC4=CNC5=C4C(=CC=C5)OC)C)C
|
|
| InChI |
InChI=1S/C36H43N9O10S/c1-7-19-29(49)40-20(8-2)33(52)44(5)14-25(46)38-17(3)32-42-23(16-56-32)30(50)41-22(12-18-13-37-21-10-9-11-24(55-6)27(18)21)31(51)43-36(4)28(48)34(53)45(35(36)54)15-26(47)39-19/h8-11,13,16-17,19,22,34,37,53H,7,12,14-15H2,1-6H3,(H,38,46)(H,39,47)(H,40,49)(H,41,50)(H,43,51)/b20-8-/t17-,19-,22+,34+,36+/m1/s1
|
|
| InChIKey |
ZSZUTDYWMWIAKG-VSBDOLEISA-N
|
|
| Synonyms |
Zelkovamycin B
|
|
| CAS | NA | |
| PubChem CID | 156582956 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 793.8 | ALogp: | 0.4 |
| HBD: | 7 | HBA: | 12 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 290.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 56 | QED Weighted: | 0.132 |
| Caco-2 Permeability: | -5.741 | MDCK Permeability: | 0.00000360 |
| Pgp-inhibitor: | 0.02 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.856 | 20% Bioavailability (F20%): | 0.998 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.185 | Plasma Protein Binding (PPB): | 65.20% |
| Volume Distribution (VD): | 0.254 | Fu: | 44.37% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.086 |
| CYP2C19-inhibitor: | 0.105 | CYP2C19-substrate: | 0.042 |
| CYP2C9-inhibitor: | 0.248 | CYP2C9-substrate: | 0.262 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.075 |
| CYP3A4-inhibitor: | 0.135 | CYP3A4-substrate: | 0.108 |
| Clearance (CL): | 2.34 | Half-life (T1/2): | 0.693 |
| hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.501 |
| Drug-inuced Liver Injury (DILI): | 0.967 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.14 | Maximum Recommended Daily Dose: | 0.729 |
| Skin Sensitization: | 0.152 | Carcinogencity: | 0.096 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.003 |
| Respiratory Toxicity: | 0.654 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004435 | ![]() |
0.739 | D09ZIO | ![]() |
0.279 | ||
| ENC004434 | ![]() |
0.714 | D0X9PF | ![]() |
0.241 | ||
| ENC004432 | ![]() |
0.704 | D0L7LC | ![]() |
0.236 | ||
| ENC002016 | ![]() |
0.702 | D0M2YE | ![]() |
0.235 | ||
| ENC005139 | ![]() |
0.314 | D07DSQ | ![]() |
0.227 | ||
| ENC005563 | ![]() |
0.302 | D02XIY | ![]() |
0.226 | ||
| ENC005343 | ![]() |
0.292 | D0E2OU | ![]() |
0.226 | ||
| ENC002515 | ![]() |
0.269 | D07XGH | ![]() |
0.217 | ||
| ENC005276 | ![]() |
0.269 | D05MNW | ![]() |
0.217 | ||
| ENC002514 | ![]() |
0.262 | D00TLP | ![]() |
0.216 | ||