|
Name |
Thiocladospolide I
|
| Molecular Formula | C27H44O10S | |
| IUPAC Name* |
(4S,11R)-4-hydroxy-11-[(2S)-2-hydroxy-3-[[(3S,6S,12R)-6-hydroxy-12-methyl-2,5-dioxo-oxacyclododec-3-yl]sulfanyl]propanoyl]oxydodec-2-enoic acid
|
|
| SMILES |
C[C@@H]1CCCCC[C@@H](C(=O)C[C@@H](C(=O)O1)SC[C@H](C(=O)O[C@H](C)CCCCCC[C@@H](C=CC(=O)O)O)O)O
|
|
| InChI |
InChI=1S/C27H44O10S/c1-18(10-6-3-4-8-12-20(28)14-15-25(32)33)36-26(34)23(31)17-38-24-16-22(30)21(29)13-9-5-7-11-19(2)37-27(24)35/h14-15,18-21,23-24,28-29,31H,3-13,16-17H2,1-2H3,(H,32,33)/t18-,19-,20+,21+,23-,24+/m1/s1
|
|
| InChIKey |
WNKIJOAGEYHZFZ-BXFVOWPLSA-N
|
|
| Synonyms |
Thiocladospolide I
|
|
| CAS | NA | |
| PubChem CID | 156582698 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 560.7 | ALogp: | 3.5 |
| HBD: | 4 | HBA: | 11 |
| Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 193.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 38 | QED Weighted: | 0.139 |
| Caco-2 Permeability: | -5.42 | MDCK Permeability: | 0.00001600 |
| Pgp-inhibitor: | 0.945 | Pgp-substrate: | 0.946 |
| Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.875 |
| 30% Bioavailability (F30%): | 0.923 |
| Blood-Brain-Barrier Penetration (BBB): | 0.073 | Plasma Protein Binding (PPB): | 88.04% |
| Volume Distribution (VD): | 0.361 | Fu: | 5.30% |
| CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.04 |
| CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.047 |
| CYP2C9-inhibitor: | 0.047 | CYP2C9-substrate: | 0.992 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.08 |
| CYP3A4-inhibitor: | 0.024 | CYP3A4-substrate: | 0.023 |
| Clearance (CL): | 5.606 | Half-life (T1/2): | 0.931 |
| hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.425 |
| Drug-inuced Liver Injury (DILI): | 0.69 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.064 | Maximum Recommended Daily Dose: | 0.969 |
| Skin Sensitization: | 0.341 | Carcinogencity: | 0.241 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.017 |
| Respiratory Toxicity: | 0.05 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004422 | ![]() |
0.699 | D0I4DQ | ![]() |
0.311 | ||
| ENC004419 | ![]() |
0.551 | D0N3NO | ![]() |
0.299 | ||
| ENC002048 | ![]() |
0.457 | D06FEA | ![]() |
0.281 | ||
| ENC003570 | ![]() |
0.427 | D0ZI4H | ![]() |
0.280 | ||
| ENC004420 | ![]() |
0.414 | D0V0IX | ![]() |
0.279 | ||
| ENC002063 | ![]() |
0.376 | D0X8KY | ![]() |
0.253 | ||
| ENC004708 | ![]() |
0.374 | D03KYG | ![]() |
0.241 | ||
| ENC003308 | ![]() |
0.374 | D03JSJ | ![]() |
0.235 | ||
| ENC004418 | ![]() |
0.327 | D0D9NY | ![]() |
0.228 | ||
| ENC004121 | ![]() |
0.325 | D09ANG | ![]() |
0.228 | ||