![]() |
Name |
(2S,4R,2'S,4'R)-4,4'-oxybis(5-methoxy-2-methyl-3,4-dihydro-2H-1-benzopyran)
|
Molecular Formula | C22H26O5 | |
IUPAC Name* |
(2S,4R)-5-methoxy-4-[[(2S,4R)-5-methoxy-2-methyl-3,4-dihydro-2H-chromen-4-yl]oxy]-2-methyl-3,4-dihydro-2H-chromene
|
|
SMILES |
C[C@H]1C[C@H](C2=C(O1)C=CC=C2OC)O[C@@H]3C[C@@H](OC4=C3C(=CC=C4)OC)C
|
|
InChI |
InChI=1S/C22H26O5/c1-13-11-19(21-15(23-3)7-5-9-17(21)25-13)27-20-12-14(2)26-18-10-6-8-16(24-4)22(18)20/h5-10,13-14,19-20H,11-12H2,1-4H3/t13-,14-,19+,20+/m0/s1
|
|
InChIKey |
WYGWBWYDNRLBJN-AFHBHXEDSA-N
|
|
Synonyms |
(2S,4R,2'S,4'R)-4,4'-oxybis(5-methoxy-2-methyl-3,4-dihydro-2H-1-benzopyran)
|
|
CAS | NA | |
PubChem CID | 156582494 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 370.4 | ALogp: | 4.1 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 27 | QED Weighted: | 0.737 |
Caco-2 Permeability: | -4.684 | MDCK Permeability: | 0.00003700 |
Pgp-inhibitor: | 0.906 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.117 | Plasma Protein Binding (PPB): | 94.25% |
Volume Distribution (VD): | 0.742 | Fu: | 3.18% |
CYP1A2-inhibitor: | 0.263 | CYP1A2-substrate: | 0.801 |
CYP2C19-inhibitor: | 0.967 | CYP2C19-substrate: | 0.923 |
CYP2C9-inhibitor: | 0.82 | CYP2C9-substrate: | 0.955 |
CYP2D6-inhibitor: | 0.549 | CYP2D6-substrate: | 0.931 |
CYP3A4-inhibitor: | 0.915 | CYP3A4-substrate: | 0.8 |
Clearance (CL): | 6.796 | Half-life (T1/2): | 0.161 |
hERG Blockers: | 0.247 | Human Hepatotoxicity (H-HT): | 0.954 |
Drug-inuced Liver Injury (DILI): | 0.949 | AMES Toxicity: | 0.95 |
Rat Oral Acute Toxicity: | 0.142 | Maximum Recommended Daily Dose: | 0.993 |
Skin Sensitization: | 0.622 | Carcinogencity: | 0.384 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.324 |
Respiratory Toxicity: | 0.848 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004093 | ![]() |
0.419 | D08CCE | ![]() |
0.305 | ||
ENC003969 | ![]() |
0.398 | D0F7CS | ![]() |
0.293 | ||
ENC004394 | ![]() |
0.398 | D03MIR | ![]() |
0.284 | ||
ENC005841 | ![]() |
0.398 | D0D4HN | ![]() |
0.266 | ||
ENC005842 | ![]() |
0.398 | D01SAT | ![]() |
0.265 | ||
ENC001512 | ![]() |
0.376 | D06TQZ | ![]() |
0.256 | ||
ENC004820 | ![]() |
0.366 | D0L1JW | ![]() |
0.256 | ||
ENC002689 | ![]() |
0.349 | D04TDQ | ![]() |
0.256 | ||
ENC005240 | ![]() |
0.349 | D0NJ3V | ![]() |
0.254 | ||
ENC004837 | ![]() |
0.327 | D0NS6H | ![]() |
0.254 |