|
Name |
(-)-acrozine B
|
| Molecular Formula | C16H19N3O4S | |
| IUPAC Name* |
(3R,6R)-6-(hydroxymethyl)-3-(1H-indol-3-ylmethyl)-1-methoxy-3-methylsulfanylpiperazine-2,5-dione
|
|
| SMILES |
CON1[C@@H](C(=O)N[C@](C1=O)(CC2=CNC3=CC=CC=C32)SC)CO
|
|
| InChI |
InChI=1S/C16H19N3O4S/c1-23-19-13(9-20)14(21)18-16(24-2,15(19)22)7-10-8-17-12-6-4-3-5-11(10)12/h3-6,8,13,17,20H,7,9H2,1-2H3,(H,18,21)/t13-,16-/m1/s1
|
|
| InChIKey |
URSNEXGMZBGKLE-CZUORRHYSA-N
|
|
| Synonyms |
(-)-acrozine B
|
|
| CAS | NA | |
| PubChem CID | 156582031 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 349.4 | ALogp: | 1.5 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 120.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.75 |
| Caco-2 Permeability: | -4.58 | MDCK Permeability: | 0.00000484 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.296 |
| Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.047 |
| Blood-Brain-Barrier Penetration (BBB): | 0.786 | Plasma Protein Binding (PPB): | 77.23% |
| Volume Distribution (VD): | 0.602 | Fu: | 48.22% |
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.819 |
| CYP2C19-inhibitor: | 0.588 | CYP2C19-substrate: | 0.672 |
| CYP2C9-inhibitor: | 0.399 | CYP2C9-substrate: | 0.82 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.111 |
| CYP3A4-inhibitor: | 0.182 | CYP3A4-substrate: | 0.92 |
| Clearance (CL): | 5.881 | Half-life (T1/2): | 0.845 |
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.341 |
| Drug-inuced Liver Injury (DILI): | 0.947 | AMES Toxicity: | 0.04 |
| Rat Oral Acute Toxicity: | 0.36 | Maximum Recommended Daily Dose: | 0.039 |
| Skin Sensitization: | 0.118 | Carcinogencity: | 0.061 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.007 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004344 | ![]() |
1.000 | D05EJG | ![]() |
0.363 | ||
| ENC004343 | ![]() |
1.000 | D07RGW | ![]() |
0.306 | ||
| ENC004342 | ![]() |
1.000 | D0AN7B | ![]() |
0.292 | ||
| ENC005916 | ![]() |
1.000 | D08UMH | ![]() |
0.289 | ||
| ENC005917 | ![]() |
1.000 | D02DMQ | ![]() |
0.283 | ||
| ENC003991 | ![]() |
0.617 | D0NG7O | ![]() |
0.283 | ||
| ENC004347 | ![]() |
0.598 | D00YLW | ![]() |
0.280 | ||
| ENC004346 | ![]() |
0.598 | D0K0KH | ![]() |
0.280 | ||
| ENC005918 | ![]() |
0.598 | D0E3WQ | ![]() |
0.275 | ||
| ENC004870 | ![]() |
0.576 | D0W7WC | ![]() |
0.272 | ||