|
Name |
Penispirozine E
|
| Molecular Formula | C20H22N2O9 | |
| IUPAC Name* |
(2R,3aR,4S,5R,7aS)-3a,4,5-trihydroxy-6'-[(2-hydroxy-3,4-dimethoxyphenyl)methylidene]spiro[3,4,5,7a-tetrahydro-1-benzofuran-2,3'-piperazine]-2',5'-dione
|
|
| SMILES |
COC1=C(C(=C(C=C1)C=C2C(=O)N[C@@]3(C[C@@]4([C@@H](O3)C=C[C@H]([C@@H]4O)O)O)C(=O)N2)O)OC
|
|
| InChI |
InChI=1S/C20H22N2O9/c1-29-12-5-3-9(14(24)15(12)30-2)7-10-17(26)22-20(18(27)21-10)8-19(28)13(31-20)6-4-11(23)16(19)25/h3-7,11,13,16,23-25,28H,8H2,1-2H3,(H,21,27)(H,22,26)/t11-,13+,16+,19+,20-/m1/s1
|
|
| InChIKey |
SVZSHNMALOJOKU-UDIIKYEGSA-N
|
|
| Synonyms |
Penispirozine E
|
|
| CAS | NA | |
| PubChem CID | 156580834 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 434.4 | ALogp: | -1.5 |
| HBD: | 6 | HBA: | 9 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 167.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 31 | QED Weighted: | 0.26 |
| Caco-2 Permeability: | -5.872 | MDCK Permeability: | 0.00000559 |
| Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.563 |
| Human Intestinal Absorption (HIA): | 0.61 | 20% Bioavailability (F20%): | 0.395 |
| 30% Bioavailability (F30%): | 0.964 |
| Blood-Brain-Barrier Penetration (BBB): | 0.69 | Plasma Protein Binding (PPB): | 75.66% |
| Volume Distribution (VD): | 0.521 | Fu: | 21.73% |
| CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.956 |
| CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.088 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.412 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.17 |
| CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.157 |
| Clearance (CL): | 3.188 | Half-life (T1/2): | 0.914 |
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.229 |
| Drug-inuced Liver Injury (DILI): | 0.962 | AMES Toxicity: | 0.105 |
| Rat Oral Acute Toxicity: | 0.147 | Maximum Recommended Daily Dose: | 0.013 |
| Skin Sensitization: | 0.441 | Carcinogencity: | 0.093 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.063 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004281 | ![]() |
1.000 | D06GCK | ![]() |
0.273 | ||
| ENC004282 | ![]() |
0.773 | D03DIG | ![]() |
0.254 | ||
| ENC004283 | ![]() |
0.773 | D01XWG | ![]() |
0.253 | ||
| ENC004278 | ![]() |
0.753 | D0L1JW | ![]() |
0.250 | ||
| ENC004279 | ![]() |
0.753 | D0C9XJ | ![]() |
0.248 | ||
| ENC004276 | ![]() |
0.598 | D07VLY | ![]() |
0.248 | ||
| ENC003738 | ![]() |
0.513 | D07MGA | ![]() |
0.248 | ||
| ENC003659 | ![]() |
0.455 | D04TDQ | ![]() |
0.232 | ||
| ENC004277 | ![]() |
0.447 | D0D4HN | ![]() |
0.232 | ||
| ENC006030 | ![]() |
0.419 | D09DHY | ![]() |
0.231 | ||