|
Name |
Strepimidazole C
|
| Molecular Formula | C12H21N3O | |
| IUPAC Name* |
(6S)-1-(2-amino-1H-imidazol-5-yl)-6-methyloctan-1-one
|
|
| SMILES |
CC[C@H](C)CCCCC(=O)C1=CN=C(N1)N
|
|
| InChI |
InChI=1S/C12H21N3O/c1-3-9(2)6-4-5-7-11(16)10-8-14-12(13)15-10/h8-9H,3-7H2,1-2H3,(H3,13,14,15)/t9-/m0/s1
|
|
| InChIKey |
RLFDCUGEJGZLRC-VIFPVBQESA-N
|
|
| Synonyms |
Strepimidazole C
|
|
| CAS | NA | |
| PubChem CID | 156580784 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 223.31 | ALogp: | 3.0 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 71.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 16 | QED Weighted: | 0.548 |
| Caco-2 Permeability: | -5.048 | MDCK Permeability: | 0.00000714 |
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.923 |
| Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.326 |
| 30% Bioavailability (F30%): | 0.002 |
| Blood-Brain-Barrier Penetration (BBB): | 0.943 | Plasma Protein Binding (PPB): | 43.15% |
| Volume Distribution (VD): | 0.85 | Fu: | 57.24% |
| CYP1A2-inhibitor: | 0.102 | CYP1A2-substrate: | 0.912 |
| CYP2C19-inhibitor: | 0.267 | CYP2C19-substrate: | 0.042 |
| CYP2C9-inhibitor: | 0.106 | CYP2C9-substrate: | 0.013 |
| CYP2D6-inhibitor: | 0.394 | CYP2D6-substrate: | 0.063 |
| CYP3A4-inhibitor: | 0.046 | CYP3A4-substrate: | 0.256 |
| Clearance (CL): | 7.449 | Half-life (T1/2): | 0.916 |
| hERG Blockers: | 0.136 | Human Hepatotoxicity (H-HT): | 0.984 |
| Drug-inuced Liver Injury (DILI): | 0.847 | AMES Toxicity: | 0.096 |
| Rat Oral Acute Toxicity: | 0.88 | Maximum Recommended Daily Dose: | 0.929 |
| Skin Sensitization: | 0.86 | Carcinogencity: | 0.941 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.166 |
| Respiratory Toxicity: | 0.966 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004273 | ![]() |
0.771 | D0G2KD | ![]() |
0.262 | ||
| ENC004272 | ![]() |
0.760 | D0UU9Y | ![]() |
0.238 | ||
| ENC004275 | ![]() |
0.750 | D0FD0H | ![]() |
0.236 | ||
| ENC004270 | ![]() |
0.694 | D04QJD | ![]() |
0.230 | ||
| ENC004269 | ![]() |
0.654 | D00DEF | ![]() |
0.228 | ||
| ENC004271 | ![]() |
0.607 | D05MFA | ![]() |
0.227 | ||
| ENC000554 | ![]() |
0.365 | D09QEI | ![]() |
0.225 | ||
| ENC000551 | ![]() |
0.358 | D0U5CE | ![]() |
0.221 | ||
| ENC001154 | ![]() |
0.345 | D03LGG | ![]() |
0.221 | ||
| ENC000797 | ![]() |
0.345 | D07BYK | ![]() |
0.221 | ||