|
Name |
Remisporine B
|
| Molecular Formula | C30H24O12 | |
| IUPAC Name* |
dimethyl (1S,12S,14S,15R,27R)-8,14,23-trihydroxy-6,21-dimethyl-10,25-dioxo-3,13,18-trioxaheptacyclo[13.11.1.02,11.04,9.012,27.017,26.019,24]heptacosa-2(11),4,6,8,17(26),19,21,23-octaene-12,14-dicarboxylate
|
|
| SMILES |
CC1=CC(=C2C(=C1)OC3=C(C2=O)[C@@H]4[C@@H]5[C@@H](C3)[C@](O[C@@]5(C6=C4OC7=CC(=CC(=C7C6=O)O)C)C(=O)OC)(C(=O)OC)O)O
|
|
| InChI |
InChI=1S/C30H24O12/c1-10-5-13(31)18-15(7-10)40-17-9-12-22-21(20(17)24(18)33)26-23(25(34)19-14(32)6-11(2)8-16(19)41-26)29(22,27(35)38-3)42-30(12,37)28(36)39-4/h5-8,12,21-22,31-32,37H,9H2,1-4H3/t12-,21-,22+,29+,30+/m1/s1
|
|
| InChIKey |
RRGJMIUFDPLICY-JJEZGDBSSA-N
|
|
| Synonyms |
Remisporine B; Dimethyl (1S,12S,14S,15R,27R)-8,14,23-trihydroxy-6,21-dimethyl-10,25-dioxo-3,13,18-trioxaheptacyclo[13.11.1.02,11.04,9.012,27.017,26.019,24]heptacosa-2(11),4,6,8,17(26),19,21,23-octaene-12,14-dicarboxylate
|
|
| CAS | NA | |
| PubChem CID | 155859171 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 576.5 | ALogp: | 2.9 |
| HBD: | 3 | HBA: | 12 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 175.0 | Aromatic Rings: | 7 |
| Heavy Atoms: | 42 | QED Weighted: | 0.297 |
| Caco-2 Permeability: | -4.945 | MDCK Permeability: | 0.00003070 |
| Pgp-inhibitor: | 0.2 | Pgp-substrate: | 0.352 |
| Human Intestinal Absorption (HIA): | 0.339 | 20% Bioavailability (F20%): | 0.049 |
| 30% Bioavailability (F30%): | 0.995 |
| Blood-Brain-Barrier Penetration (BBB): | 0.025 | Plasma Protein Binding (PPB): | 86.99% |
| Volume Distribution (VD): | 0.855 | Fu: | 9.61% |
| CYP1A2-inhibitor: | 0.054 | CYP1A2-substrate: | 0.993 |
| CYP2C19-inhibitor: | 0.624 | CYP2C19-substrate: | 0.804 |
| CYP2C9-inhibitor: | 0.862 | CYP2C9-substrate: | 0.072 |
| CYP2D6-inhibitor: | 0.048 | CYP2D6-substrate: | 0.22 |
| CYP3A4-inhibitor: | 0.468 | CYP3A4-substrate: | 0.923 |
| Clearance (CL): | 1.102 | Half-life (T1/2): | 0.047 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.941 |
| Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.183 |
| Rat Oral Acute Toxicity: | 0.993 | Maximum Recommended Daily Dose: | 0.85 |
| Skin Sensitization: | 0.062 | Carcinogencity: | 0.052 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.027 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003641 | ![]() |
1.000 | D06GCK | ![]() |
0.243 | ||
| ENC004290 | ![]() |
0.401 | D0K8KX | ![]() |
0.241 | ||
| ENC002523 | ![]() |
0.382 | D0FX2Q | ![]() |
0.240 | ||
| ENC003136 | ![]() |
0.380 | D03RTK | ![]() |
0.237 | ||
| ENC002462 | ![]() |
0.378 | D0Q0PR | ![]() |
0.232 | ||
| ENC005168 | ![]() |
0.358 | D06NSS | ![]() |
0.228 | ||
| ENC001749 | ![]() |
0.357 | D0G7IY | ![]() |
0.228 | ||
| ENC005167 | ![]() |
0.346 | D04AIT | ![]() |
0.227 | ||
| ENC002197 | ![]() |
0.343 | D0R6RC | ![]() |
0.226 | ||
| ENC004756 | ![]() |
0.343 | D01XWG | ![]() |
0.225 | ||