![]() |
Name |
Nigirpexin C
|
Molecular Formula | C15H20O4 | |
IUPAC Name* |
(3S,6S,7R)-6,7-dihydroxy-7-methyl-3-[(1E,3E)-penta-1,3-dienyl]-3,4,5,6-tetrahydro-1H-isochromen-8-one
|
|
SMILES |
C/C=C/C=C/[C@@H]1CC2=C(CO1)C(=O)[C@]([C@H](C2)O)(C)O
|
|
InChI |
InChI=1S/C15H20O4/c1-3-4-5-6-11-7-10-8-13(16)15(2,18)14(17)12(10)9-19-11/h3-6,11,13,16,18H,7-9H2,1-2H3/b4-3+,6-5+/t11-,13+,15-/m1/s1
|
|
InChIKey |
YULGBWALIANZCW-WDBKTXKOSA-N
|
|
Synonyms |
Nigirpexin C
|
|
CAS | NA | |
PubChem CID | 146684396 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 264.32 | ALogp: | 0.4 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.746 |
Caco-2 Permeability: | -4.374 | MDCK Permeability: | 0.00001950 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.173 |
Human Intestinal Absorption (HIA): | 0.079 | 20% Bioavailability (F20%): | 0.944 |
30% Bioavailability (F30%): | 0.807 |
Blood-Brain-Barrier Penetration (BBB): | 0.966 | Plasma Protein Binding (PPB): | 47.58% |
Volume Distribution (VD): | 0.991 | Fu: | 49.77% |
CYP1A2-inhibitor: | 0.093 | CYP1A2-substrate: | 0.506 |
CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.704 |
CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.816 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.452 |
CYP3A4-inhibitor: | 0.057 | CYP3A4-substrate: | 0.195 |
Clearance (CL): | 2.039 | Half-life (T1/2): | 0.499 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.653 |
Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.765 |
Rat Oral Acute Toxicity: | 0.971 | Maximum Recommended Daily Dose: | 0.804 |
Skin Sensitization: | 0.322 | Carcinogencity: | 0.542 |
Eye Corrosion: | 0.027 | Eye Irritation: | 0.213 |
Respiratory Toxicity: | 0.952 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005503 | ![]() |
0.438 | D0G6AB | ![]() |
0.200 | ||
ENC004211 | ![]() |
0.408 | D04VIS | ![]() |
0.200 | ||
ENC002495 | ![]() |
0.408 | D0W3OS | ![]() |
0.184 | ||
ENC004210 | ![]() |
0.342 | D0L2LS | ![]() |
0.182 | ||
ENC003691 | ![]() |
0.337 | D0Q6NZ | ![]() |
0.180 | ||
ENC004111 | ![]() |
0.321 | D0G5CF | ![]() |
0.175 | ||
ENC003396 | ![]() |
0.313 | D0N1TP | ![]() |
0.175 | ||
ENC003888 | ![]() |
0.281 | D02NSF | ![]() |
0.175 | ||
ENC005984 | ![]() |
0.280 | D01QUS | ![]() |
0.174 | ||
ENC004110 | ![]() |
0.278 | D0H1QY | ![]() |
0.174 |