![]() |
Name |
Prochaetoviridin A
|
Molecular Formula | C16H18O4 | |
IUPAC Name* |
6,8-dihydroxy-7-methyl-3-[(3S)-3-methylpent-1-enyl]isochromen-1-one
|
|
SMILES |
CC[C@H](C)C=CC1=CC2=CC(=C(C(=C2C(=O)O1)O)C)O
|
|
InChI |
InChI=1S/C16H18O4/c1-4-9(2)5-6-12-7-11-8-13(17)10(3)15(18)14(11)16(19)20-12/h5-9,17-18H,4H2,1-3H3/t9-/m0/s1
|
|
InChIKey |
NLAYPOZVXVQKKZ-VIFPVBQESA-N
|
|
Synonyms |
Prochaetoviridin A
|
|
CAS | NA | |
PubChem CID | 146684092 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 274.31 | ALogp: | 4.4 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.875 |
Caco-2 Permeability: | -4.845 | MDCK Permeability: | 0.00001830 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.281 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.028 |
30% Bioavailability (F30%): | 0.328 |
Blood-Brain-Barrier Penetration (BBB): | 0.039 | Plasma Protein Binding (PPB): | 99.13% |
Volume Distribution (VD): | 0.348 | Fu: | 2.65% |
CYP1A2-inhibitor: | 0.975 | CYP1A2-substrate: | 0.896 |
CYP2C19-inhibitor: | 0.352 | CYP2C19-substrate: | 0.116 |
CYP2C9-inhibitor: | 0.735 | CYP2C9-substrate: | 0.877 |
CYP2D6-inhibitor: | 0.635 | CYP2D6-substrate: | 0.494 |
CYP3A4-inhibitor: | 0.459 | CYP3A4-substrate: | 0.167 |
Clearance (CL): | 6.878 | Half-life (T1/2): | 0.483 |
hERG Blockers: | 0.038 | Human Hepatotoxicity (H-HT): | 0.625 |
Drug-inuced Liver Injury (DILI): | 0.877 | AMES Toxicity: | 0.044 |
Rat Oral Acute Toxicity: | 0.5 | Maximum Recommended Daily Dose: | 0.896 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.743 |
Eye Corrosion: | 0.024 | Eye Irritation: | 0.629 |
Respiratory Toxicity: | 0.831 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003541 | ![]() |
0.594 | D0FA2O | ![]() |
0.263 | ||
ENC005422 | ![]() |
0.458 | D06GCK | ![]() |
0.255 | ||
ENC003370 | ![]() |
0.455 | D0K8KX | ![]() |
0.239 | ||
ENC005905 | ![]() |
0.449 | D08HUC | ![]() |
0.238 | ||
ENC001518 | ![]() |
0.446 | D0Z1WA | ![]() |
0.233 | ||
ENC005334 | ![]() |
0.435 | D04AIT | ![]() |
0.231 | ||
ENC001940 | ![]() |
0.424 | D0QV5T | ![]() |
0.226 | ||
ENC005232 | ![]() |
0.419 | D0O6KE | ![]() |
0.225 | ||
ENC005802 | ![]() |
0.397 | D06GIP | ![]() |
0.221 | ||
ENC006097 | ![]() |
0.397 | D0J1VY | ![]() |
0.217 |