![]() |
Name |
Paralactonic acid D
|
Molecular Formula | C12H16O6 | |
IUPAC Name* |
3-[(2S,3S)-5-(2-carboxyethyl)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]propanoic acid
|
|
SMILES |
C[C@H]1C=C(C(=O)O[C@H]1CCC(=O)O)CCC(=O)O
|
|
InChI |
InChI=1S/C12H16O6/c1-7-6-8(2-4-10(13)14)12(17)18-9(7)3-5-11(15)16/h6-7,9H,2-5H2,1H3,(H,13,14)(H,15,16)/t7-,9-/m0/s1
|
|
InChIKey |
STMLBESERUTGPE-CBAPKCEASA-N
|
|
Synonyms |
Paralactonic acid D
|
|
CAS | NA | |
PubChem CID | 146683308 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 256.25 | ALogp: | 0.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 101.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.701 |
Caco-2 Permeability: | -5.9 | MDCK Permeability: | 0.00040344 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.244 |
Human Intestinal Absorption (HIA): | 0.065 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.55 |
Blood-Brain-Barrier Penetration (BBB): | 0.142 | Plasma Protein Binding (PPB): | 58.77% |
Volume Distribution (VD): | 0.2 | Fu: | 46.75% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.052 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.042 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.974 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.133 |
CYP3A4-inhibitor: | 0.014 | CYP3A4-substrate: | 0.036 |
Clearance (CL): | 4.361 | Half-life (T1/2): | 0.862 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.613 |
Drug-inuced Liver Injury (DILI): | 0.591 | AMES Toxicity: | 0.159 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.106 |
Skin Sensitization: | 0.32 | Carcinogencity: | 0.392 |
Eye Corrosion: | 0.778 | Eye Irritation: | 0.113 |
Respiratory Toxicity: | 0.089 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004112 | ![]() |
0.545 | D06VNK | ![]() |
0.360 | ||
ENC004110 | ![]() |
0.470 | D0E4WR | ![]() |
0.317 | ||
ENC000062 | ![]() |
0.360 | D0Y7ZD | ![]() |
0.268 | ||
ENC004111 | ![]() |
0.356 | D0O4GY | ![]() |
0.263 | ||
ENC005800 | ![]() |
0.350 | D00ENY | ![]() |
0.259 | ||
ENC005801 | ![]() |
0.348 | D0Z0MG | ![]() |
0.246 | ||
ENC003677 | ![]() |
0.344 | D03CEF | ![]() |
0.232 | ||
ENC003800 | ![]() |
0.322 | D07SJT | ![]() |
0.229 | ||
ENC000075 | ![]() |
0.317 | D0W5BS | ![]() |
0.224 | ||
ENC005799 | ![]() |
0.313 | D0EP8X | ![]() |
0.222 |