NPs Basic Information
|
Name |
Penicixanthene C
|
| Molecular Formula | C20H22O5 | |
| IUPAC Name* |
1-[(9S)-3,8-dihydroxy-9-[(2R)-2-hydroxypropyl]-9H-xanthen-4-yl]butan-1-one
|
|
| SMILES |
CCCC(=O)C1=C(C=CC2=C1OC3=CC=CC(=C3[C@H]2C[C@@H](C)O)O)O
|
|
| InChI |
InChI=1S/C20H22O5/c1-3-5-14(22)19-16(24)9-8-12-13(10-11(2)21)18-15(23)6-4-7-17(18)25-20(12)19/h4,6-9,11,13,21,23-24H,3,5,10H2,1-2H3/t11-,13+/m1/s1
|
|
| InChIKey |
KEYSMLGWCOGLMJ-YPMHNXCESA-N
|
|
| Synonyms |
Penicixanthene C
|
|
| CAS | NA | |
| PubChem CID | 146683108 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 342.4 | ALogp: | 3.7 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 87.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 25 | QED Weighted: | 0.686 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.026 | MDCK Permeability: | 0.00001960 |
| Pgp-inhibitor: | 0.022 | Pgp-substrate: | 0.935 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.29 |
| 30% Bioavailability (F30%): | 0.464 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.087 | Plasma Protein Binding (PPB): | 97.06% |
| Volume Distribution (VD): | 0.648 | Fu: | 2.95% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.854 | CYP1A2-substrate: | 0.888 |
| CYP2C19-inhibitor: | 0.918 | CYP2C19-substrate: | 0.702 |
| CYP2C9-inhibitor: | 0.912 | CYP2C9-substrate: | 0.985 |
| CYP2D6-inhibitor: | 0.732 | CYP2D6-substrate: | 0.721 |
| CYP3A4-inhibitor: | 0.359 | CYP3A4-substrate: | 0.719 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.31 | Half-life (T1/2): | 0.469 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.043 |
| Drug-inuced Liver Injury (DILI): | 0.58 | AMES Toxicity: | 0.211 |
| Rat Oral Acute Toxicity: | 0.955 | Maximum Recommended Daily Dose: | 0.992 |
| Skin Sensitization: | 0.373 | Carcinogencity: | 0.683 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.823 |
| Respiratory Toxicity: | 0.893 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004094 |  |
1.000 | D0U3YB |  |
0.290 | ||
| ENC004096 |  |
0.469 | D02FCQ |  |
0.290 | ||
| ENC001513 |  |
0.444 | D0H6QU |  |
0.273 | ||
| ENC002976 |  |
0.414 | D0J7RK |  |
0.272 | ||
| ENC002237 |  |
0.408 | D0A8XN |  |
0.271 | ||
| ENC002350 |  |
0.395 | D0JY5S |  |
0.261 | ||
| ENC002881 |  |
0.385 | D0Z1WA |  |
0.260 | ||
| ENC005677 |  |
0.362 | D03DJL |  |
0.258 | ||
| ENC004413 |  |
0.361 | D0I8FI |  |
0.253 | ||
| ENC002284 |  |
0.351 | D08HUC |  |
0.253 | ||