![]() |
Name |
6-(2'S-hydroxy-1'-heptyl)-4-hydroxy-3-methyl-2H-pyran-2-one
|
Molecular Formula | C13H20O4 | |
IUPAC Name* |
4-hydroxy-6-[(2S)-2-hydroxyheptyl]-3-methylpyran-2-one
|
|
SMILES |
CCCCC[C@@H](CC1=CC(=C(C(=O)O1)C)O)O
|
|
InChI |
InChI=1S/C13H20O4/c1-3-4-5-6-10(14)7-11-8-12(15)9(2)13(16)17-11/h8,10,14-15H,3-7H2,1-2H3/t10-/m0/s1
|
|
InChIKey |
GOWBICSYEMLKIU-JTQLQIEISA-N
|
|
Synonyms |
6-(2'S-hydroxy-1'-heptyl)-4 -hydroxy-3-methyl-2H-pyran-2-one
|
|
CAS | NA | |
PubChem CID | 146682579 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 240.29 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.75 |
Caco-2 Permeability: | -4.652 | MDCK Permeability: | 0.00002180 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.93 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.07 |
30% Bioavailability (F30%): | 0.578 |
Blood-Brain-Barrier Penetration (BBB): | 0.348 | Plasma Protein Binding (PPB): | 92.21% |
Volume Distribution (VD): | 0.49 | Fu: | 14.22% |
CYP1A2-inhibitor: | 0.331 | CYP1A2-substrate: | 0.918 |
CYP2C19-inhibitor: | 0.109 | CYP2C19-substrate: | 0.74 |
CYP2C9-inhibitor: | 0.304 | CYP2C9-substrate: | 0.902 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.464 |
CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.138 |
Clearance (CL): | 8.965 | Half-life (T1/2): | 0.768 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.144 |
Drug-inuced Liver Injury (DILI): | 0.165 | AMES Toxicity: | 0.028 |
Rat Oral Acute Toxicity: | 0.052 | Maximum Recommended Daily Dose: | 0.302 |
Skin Sensitization: | 0.526 | Carcinogencity: | 0.539 |
Eye Corrosion: | 0.125 | Eye Irritation: | 0.697 |
Respiratory Toxicity: | 0.094 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004625 | ![]() |
0.680 | D0O1UZ | ![]() |
0.267 | ||
ENC004050 | ![]() |
0.643 | D0P1FO | ![]() |
0.264 | ||
ENC002813 | ![]() |
0.600 | D0L7AS | ![]() |
0.263 | ||
ENC004199 | ![]() |
0.536 | D01WUA | ![]() |
0.250 | ||
ENC004559 | ![]() |
0.517 | D00HCQ | ![]() |
0.226 | ||
ENC004049 | ![]() |
0.484 | D06FEA | ![]() |
0.223 | ||
ENC002803 | ![]() |
0.467 | D0I4DQ | ![]() |
0.223 | ||
ENC005393 | ![]() |
0.463 | D0V0IX | ![]() |
0.221 | ||
ENC004938 | ![]() |
0.457 | D02MLW | ![]() |
0.216 | ||
ENC002549 | ![]() |
0.441 | D0U5CE | ![]() |
0.216 |