![]() |
Name |
Fusaricate H
|
Molecular Formula | C14H21NO3 | |
IUPAC Name* |
[(2R,3R)-3-hydroxybutan-2-yl] 5-butylpyridine-2-carboxylate
|
|
SMILES |
CCCCC1=CN=C(C=C1)C(=O)O[C@H](C)[C@@H](C)O
|
|
InChI |
InChI=1S/C14H21NO3/c1-4-5-6-12-7-8-13(15-9-12)14(17)18-11(3)10(2)16/h7-11,16H,4-6H2,1-3H3/t10-,11-/m1/s1
|
|
InChIKey |
SUNALTYKQWMYGQ-GHMZBOCLSA-N
|
|
Synonyms |
Fusaricate H
|
|
CAS | NA | |
PubChem CID | 146682367 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 251.32 | ALogp: | 3.1 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 59.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.789 |
Caco-2 Permeability: | -4.384 | MDCK Permeability: | 0.00002420 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.716 |
Blood-Brain-Barrier Penetration (BBB): | 0.639 | Plasma Protein Binding (PPB): | 89.05% |
Volume Distribution (VD): | 3.015 | Fu: | 5.41% |
CYP1A2-inhibitor: | 0.84 | CYP1A2-substrate: | 0.875 |
CYP2C19-inhibitor: | 0.696 | CYP2C19-substrate: | 0.356 |
CYP2C9-inhibitor: | 0.463 | CYP2C9-substrate: | 0.918 |
CYP2D6-inhibitor: | 0.694 | CYP2D6-substrate: | 0.529 |
CYP3A4-inhibitor: | 0.144 | CYP3A4-substrate: | 0.169 |
Clearance (CL): | 4.529 | Half-life (T1/2): | 0.453 |
hERG Blockers: | 0.076 | Human Hepatotoxicity (H-HT): | 0.052 |
Drug-inuced Liver Injury (DILI): | 0.781 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.087 | Maximum Recommended Daily Dose: | 0.027 |
Skin Sensitization: | 0.061 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.427 |
Respiratory Toxicity: | 0.059 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004033 | ![]() |
1.000 | D03XTC | ![]() |
0.321 | ||
ENC004034 | ![]() |
1.000 | D01UXC | ![]() |
0.312 | ||
ENC000096 | ![]() |
0.604 | D0R1QE | ![]() |
0.309 | ||
ENC002111 | ![]() |
0.475 | D02HXS | ![]() |
0.306 | ||
ENC004143 | ![]() |
0.443 | D0I2MK | ![]() |
0.291 | ||
ENC006094 | ![]() |
0.338 | D0HD9K | ![]() |
0.281 | ||
ENC005813 | ![]() |
0.321 | D03LGG | ![]() |
0.279 | ||
ENC000586 | ![]() |
0.316 | D0U5CE | ![]() |
0.279 | ||
ENC000074 | ![]() |
0.312 | D0KD1U | ![]() |
0.278 | ||
ENC004665 | ![]() |
0.309 | D08HQK | ![]() |
0.275 |