![]() |
Name |
Rhizophol B
|
Molecular Formula | C22H22O6 | |
IUPAC Name* |
8-hydroxy-3-methyl-2-[2-[(2R)-oxiran-2-yl]propan-2-yloxy]-1-propanoylxanthen-9-one
|
|
SMILES |
CCC(=O)C1=C(C(=CC2=C1C(=O)C3=C(C=CC=C3O2)O)C)OC(C)(C)[C@H]4CO4
|
|
InChI |
InChI=1S/C22H22O6/c1-5-12(23)18-19-15(27-14-8-6-7-13(24)17(14)20(19)25)9-11(2)21(18)28-22(3,4)16-10-26-16/h6-9,16,24H,5,10H2,1-4H3/t16-/m1/s1
|
|
InChIKey |
SZHGDNPHWKQUIJ-MRXNPFEDSA-N
|
|
Synonyms |
Rhizophol B
|
|
CAS | NA | |
PubChem CID | 146682296 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.4 | ALogp: | 4.0 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 85.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 28 | QED Weighted: | 0.39 |
Caco-2 Permeability: | -4.831 | MDCK Permeability: | 0.00001600 |
Pgp-inhibitor: | 0.08 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.025 |
Blood-Brain-Barrier Penetration (BBB): | 0.045 | Plasma Protein Binding (PPB): | 95.72% |
Volume Distribution (VD): | 0.611 | Fu: | 2.29% |
CYP1A2-inhibitor: | 0.789 | CYP1A2-substrate: | 0.907 |
CYP2C19-inhibitor: | 0.624 | CYP2C19-substrate: | 0.132 |
CYP2C9-inhibitor: | 0.876 | CYP2C9-substrate: | 0.591 |
CYP2D6-inhibitor: | 0.549 | CYP2D6-substrate: | 0.295 |
CYP3A4-inhibitor: | 0.331 | CYP3A4-substrate: | 0.409 |
Clearance (CL): | 1.814 | Half-life (T1/2): | 0.113 |
hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.927 |
Drug-inuced Liver Injury (DILI): | 0.963 | AMES Toxicity: | 0.659 |
Rat Oral Acute Toxicity: | 0.501 | Maximum Recommended Daily Dose: | 0.908 |
Skin Sensitization: | 0.43 | Carcinogencity: | 0.77 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.167 |
Respiratory Toxicity: | 0.375 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005671 | ![]() |
0.475 | D06GCK | ![]() |
0.272 | ||
ENC005672 | ![]() |
0.475 | D0Z3DY | ![]() |
0.269 | ||
ENC004887 | ![]() |
0.465 | D0O6KE | ![]() |
0.267 | ||
ENC004883 | ![]() |
0.465 | D0W7WC | ![]() |
0.262 | ||
ENC002106 | ![]() |
0.457 | D0K8KX | ![]() |
0.259 | ||
ENC002284 | ![]() |
0.457 | D0G7IY | ![]() |
0.257 | ||
ENC004886 | ![]() |
0.457 | D06NSS | ![]() |
0.248 | ||
ENC001749 | ![]() |
0.447 | D0G5UB | ![]() |
0.248 | ||
ENC005673 | ![]() |
0.441 | D0H2ZW | ![]() |
0.245 | ||
ENC005674 | ![]() |
0.441 | D0I1FQ | ![]() |
0.244 |