|
Name |
Trivirensol B
|
| Molecular Formula | C45H60O15 | |
| IUPAC Name* |
(5aS,6R,9S,9aS)-9-[[(5aS,6R,9S,9aS)-9-hydroxy-9-[[(E)-2-(hydroxymethyl)-3-[(4S,5R)-3-oxo-5-propan-2-yl-4,5,6,7-tetrahydro-1H-2-benzofuran-4-yl]prop-2-enoyl]oxymethyl]-1-oxo-6-propan-2-yl-3,5a,6,7,8,9a-hexahydro-2-benzoxepine-4-carbonyl]oxymethyl]-9-hydroxy-1-oxo-6-propan-2-yl-3,5a,6,7,8,9a-hexahydro-2-benzoxepine-4-carboxylic acid
|
|
| SMILES |
CC(C)[C@H]1CCC2=C([C@@H]1/C=C(\CO)/C(=O)OC[C@@]3(CC[C@@H]([C@@H]4[C@@H]3C(=O)OCC(=C4)C(=O)OC[C@@]5(CC[C@@H]([C@@H]6[C@@H]5C(=O)OCC(=C6)C(=O)O)C(C)C)O)C(C)C)O)C(=O)OC2
|
|
| InChI |
InChI=1S/C45H60O15/c1-22(2)29-8-7-25-17-56-41(51)35(25)32(29)13-26(16-46)39(49)59-20-44(54)12-10-31(24(5)6)34-15-28(19-58-43(53)37(34)44)40(50)60-21-45(55)11-9-30(23(3)4)33-14-27(38(47)48)18-57-42(52)36(33)45/h13-15,22-24,29-34,36-37,46,54-55H,7-12,16-21H2,1-6H3,(H,47,48)/b26-13+/t29-,30-,31-,32-,33-,34-,36-,37-,44-,45-/m1/s1
|
|
| InChIKey |
YWJHSQZZKWLTCN-FEQABAOJSA-N
|
|
| Synonyms |
CHEMBL4463460; Trivirensol B; BDBM50509324
|
|
| CAS | NA | |
| PubChem CID | 145721278 | |
| ChEMBL ID | CHEMBL4463460 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 840.9 | ALogp: | 3.5 |
| HBD: | 4 | HBA: | 15 |
| Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 230.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 60 | QED Weighted: | 0.122 |
| Caco-2 Permeability: | -5.898 | MDCK Permeability: | 0.00001650 |
| Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.606 |
| Human Intestinal Absorption (HIA): | 0.319 | 20% Bioavailability (F20%): | 0.988 |
| 30% Bioavailability (F30%): | 0.996 |
| Blood-Brain-Barrier Penetration (BBB): | 0.167 | Plasma Protein Binding (PPB): | 91.83% |
| Volume Distribution (VD): | 0.448 | Fu: | 1.71% |
| CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.091 |
| CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.056 |
| CYP2C9-inhibitor: | 0.283 | CYP2C9-substrate: | 0.015 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.042 |
| CYP3A4-inhibitor: | 0.258 | CYP3A4-substrate: | 0.556 |
| Clearance (CL): | 7.466 | Half-life (T1/2): | 0.03 |
| hERG Blockers: | 0.172 | Human Hepatotoxicity (H-HT): | 0.627 |
| Drug-inuced Liver Injury (DILI): | 0.946 | AMES Toxicity: | 0.026 |
| Rat Oral Acute Toxicity: | 0.539 | Maximum Recommended Daily Dose: | 0.967 |
| Skin Sensitization: | 0.267 | Carcinogencity: | 0.139 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
| Respiratory Toxicity: | 0.828 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004011 | ![]() |
0.732 | D0FW2A | ![]() |
0.220 | ||
| ENC004002 | ![]() |
0.627 | D0ES1Q | ![]() |
0.215 | ||
| ENC003999 | ![]() |
0.526 | D0K7HU | ![]() |
0.208 | ||
| ENC004063 | ![]() |
0.367 | D0K3QS | ![]() |
0.207 | ||
| ENC002578 | ![]() |
0.305 | D03KPZ | ![]() |
0.205 | ||
| ENC004919 | ![]() |
0.303 | D06OMK | ![]() |
0.204 | ||
| ENC005682 | ![]() |
0.264 | D0Z4UN | ![]() |
0.202 | ||
| ENC003589 | ![]() |
0.238 | D03LJR | ![]() |
0.201 | ||
| ENC005681 | ![]() |
0.237 | D0T5XN | ![]() |
0.198 | ||
| ENC004921 | ![]() |
0.236 | D0X4RS | ![]() |
0.197 | ||