![]() |
Name |
Koninginin R
|
Molecular Formula | C18H28O6 | |
IUPAC Name* |
[(2S,4R,8R)-8-hydroxy-2-[(1S)-1-hydroxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate
|
|
SMILES |
CCCCCC[C@@H]([C@@H]1C[C@H](C2=C(O1)[C@@H](CCC2=O)O)OC(=O)C)O
|
|
InChI |
InChI=1S/C18H28O6/c1-3-4-5-6-7-12(20)15-10-16(23-11(2)19)17-13(21)8-9-14(22)18(17)24-15/h12,14-16,20,22H,3-10H2,1-2H3/t12-,14+,15-,16+/m0/s1
|
|
InChIKey |
GXYWRLQZWPUUNP-DRPJVOAASA-N
|
|
Synonyms |
Koninginin R
|
|
CAS | NA | |
PubChem CID | 139591611 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 340.4 | ALogp: | 1.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.547 |
Caco-2 Permeability: | -4.658 | MDCK Permeability: | 0.00002880 |
Pgp-inhibitor: | 0.887 | Pgp-substrate: | 0.176 |
Human Intestinal Absorption (HIA): | 0.618 | 20% Bioavailability (F20%): | 0.846 |
30% Bioavailability (F30%): | 0.196 |
Blood-Brain-Barrier Penetration (BBB): | 0.369 | Plasma Protein Binding (PPB): | 52.38% |
Volume Distribution (VD): | 0.782 | Fu: | 46.89% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.096 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.409 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.459 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.134 |
CYP3A4-inhibitor: | 0.082 | CYP3A4-substrate: | 0.206 |
Clearance (CL): | 10.236 | Half-life (T1/2): | 0.899 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.278 |
Drug-inuced Liver Injury (DILI): | 0.306 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.892 | Maximum Recommended Daily Dose: | 0.28 |
Skin Sensitization: | 0.119 | Carcinogencity: | 0.641 |
Eye Corrosion: | 0.017 | Eye Irritation: | 0.096 |
Respiratory Toxicity: | 0.025 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002691 | ![]() |
0.814 | D0V0IX | ![]() |
0.308 | ||
ENC002090 | ![]() |
0.722 | D0I4DQ | ![]() |
0.298 | ||
ENC005467 | ![]() |
0.628 | D01WUA | ![]() |
0.295 | ||
ENC005892 | ![]() |
0.628 | D06FEA | ![]() |
0.286 | ||
ENC002146 | ![]() |
0.605 | D00HCQ | ![]() |
0.264 | ||
ENC002643 | ![]() |
0.605 | D0XN8C | ![]() |
0.263 | ||
ENC005927 | ![]() |
0.605 | D0N3NO | ![]() |
0.261 | ||
ENC005888 | ![]() |
0.589 | D00CTS | ![]() |
0.261 | ||
ENC003134 | ![]() |
0.570 | D0L7AS | ![]() |
0.261 | ||
ENC005889 | ![]() |
0.500 | D0ZI4H | ![]() |
0.261 |