![]() |
Name |
Isoprenylisobenzofuran A
|
Molecular Formula | C25H28O6 | |
IUPAC Name* |
(3S)-7-hydroxy-3-[(3S)-3-(2-hydroxypropan-2-yl)-7-methyl-2,3-dihydro-1,4-benzodioxin-5-yl]-4-(3-methylbut-2-enyl)-3H-2-benzofuran-1-one
|
|
SMILES |
CC1=CC(=C2C(=C1)OC[C@H](O2)C(C)(C)O)[C@@H]3C4=C(C=CC(=C4C(=O)O3)O)CC=C(C)C
|
|
InChI |
InChI=1S/C25H28O6/c1-13(2)6-7-15-8-9-17(26)21-20(15)23(31-24(21)27)16-10-14(3)11-18-22(16)30-19(12-29-18)25(4,5)28/h6,8-11,19,23,26,28H,7,12H2,1-5H3/t19-,23+/m0/s1
|
|
InChIKey |
PIRIAKYXNOUWPI-WMZHIEFXSA-N
|
|
Synonyms |
Isoprenylisobenzofuran A
|
|
CAS | NA | |
PubChem CID | 139591471 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 424.5 | ALogp: | 5.2 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 85.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.536 |
Caco-2 Permeability: | -4.714 | MDCK Permeability: | 0.00001390 |
Pgp-inhibitor: | 0.634 | Pgp-substrate: | 0.017 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.011 |
Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 92.01% |
Volume Distribution (VD): | 0.581 | Fu: | 9.48% |
CYP1A2-inhibitor: | 0.718 | CYP1A2-substrate: | 0.232 |
CYP2C19-inhibitor: | 0.46 | CYP2C19-substrate: | 0.068 |
CYP2C9-inhibitor: | 0.701 | CYP2C9-substrate: | 0.878 |
CYP2D6-inhibitor: | 0.752 | CYP2D6-substrate: | 0.438 |
CYP3A4-inhibitor: | 0.188 | CYP3A4-substrate: | 0.174 |
Clearance (CL): | 10.743 | Half-life (T1/2): | 0.124 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.477 |
Drug-inuced Liver Injury (DILI): | 0.944 | AMES Toxicity: | 0.203 |
Rat Oral Acute Toxicity: | 0.248 | Maximum Recommended Daily Dose: | 0.152 |
Skin Sensitization: | 0.436 | Carcinogencity: | 0.335 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.077 |
Respiratory Toxicity: | 0.035 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003568 | ![]() |
0.789 | D0F7CS | ![]() |
0.295 | ||
ENC003569 | ![]() |
0.789 | D0Q0PR | ![]() |
0.283 | ||
ENC003962 | ![]() |
0.651 | D04TDQ | ![]() |
0.278 | ||
ENC003963 | ![]() |
0.651 | D0L1JW | ![]() |
0.269 | ||
ENC003942 | ![]() |
0.613 | D07MGA | ![]() |
0.248 | ||
ENC004126 | ![]() |
0.604 | D00NJL | ![]() |
0.242 | ||
ENC004763 | ![]() |
0.596 | D0AZ8C | ![]() |
0.236 | ||
ENC003964 | ![]() |
0.523 | D04UTT | ![]() |
0.235 | ||
ENC003967 | ![]() |
0.523 | D0W7WC | ![]() |
0.226 | ||
ENC003966 | ![]() |
0.523 | D0L7AS | ![]() |
0.223 |