|
Name |
(1R,2R,3R,6S,7S,10S,11S,12S,13S,16R,17S)-1,12-dihydroxy-6,10,13-trimethyl-16-propan-2-ylpentacyclo[9.7.0.02,7.03,7.013,17]octadecane-2-carboxylic acid
|
| Molecular Formula | C25H40O4 | |
| IUPAC Name* |
(1R,2R,3R,6S,7S,10S,11S,12S,13S,16R,17S)-1,12-dihydroxy-6,10,13-trimethyl-16-propan-2-ylpentacyclo[9.7.0.02,7.03,7.013,17]octadecane-2-carboxylic acid
|
|
| SMILES |
C[C@H]1CC[C@]23[C@H](CC[C@H]2[C@@]3([C@@]4([C@@H]1[C@@H]([C@]5(CC[C@@H]([C@@H]5C4)C(C)C)C)O)O)C(=O)O)C
|
|
| InChI |
InChI=1S/C25H40O4/c1-13(2)16-9-10-22(5)17(16)12-24(29)19(20(22)26)14(3)8-11-23-15(4)6-7-18(23)25(23,24)21(27)28/h13-20,26,29H,6-12H2,1-5H3,(H,27,28)/t14-,15-,16+,17-,18+,19-,20-,22-,23-,24+,25+/m0/s1
|
|
| InChIKey |
UNEUBHPEGNVSJI-OUCWJSKGSA-N
|
|
| Synonyms |
Aspterpenacid B
|
|
| CAS | NA | |
| PubChem CID | 139591047 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 404.6 | ALogp: | 5.7 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 77.8 | Aromatic Rings: | 5 |
| Heavy Atoms: | 29 | QED Weighted: | 0.613 |
| Caco-2 Permeability: | -5.369 | MDCK Permeability: | 0.00002980 |
| Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.059 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.692 |
| 30% Bioavailability (F30%): | 0.924 |
| Blood-Brain-Barrier Penetration (BBB): | 0.727 | Plasma Protein Binding (PPB): | 96.87% |
| Volume Distribution (VD): | 0.518 | Fu: | 2.33% |
| CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.38 |
| CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.812 |
| CYP2C9-inhibitor: | 0.121 | CYP2C9-substrate: | 0.197 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.109 |
| CYP3A4-inhibitor: | 0.159 | CYP3A4-substrate: | 0.256 |
| Clearance (CL): | 6.895 | Half-life (T1/2): | 0.253 |
| hERG Blockers: | 0.194 | Human Hepatotoxicity (H-HT): | 0.337 |
| Drug-inuced Liver Injury (DILI): | 0.052 | AMES Toxicity: | 0.017 |
| Rat Oral Acute Toxicity: | 0.597 | Maximum Recommended Daily Dose: | 0.054 |
| Skin Sensitization: | 0.822 | Carcinogencity: | 0.428 |
| Eye Corrosion: | 0.347 | Eye Irritation: | 0.131 |
| Respiratory Toxicity: | 0.97 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003938 | ![]() |
0.783 | D0G3SH | ![]() |
0.336 | ||
| ENC003725 | ![]() |
0.434 | D03ZTE | ![]() |
0.336 | ||
| ENC004227 | ![]() |
0.364 | D0M4WA | ![]() |
0.333 | ||
| ENC006063 | ![]() |
0.364 | D0OR2L | ![]() |
0.308 | ||
| ENC002934 | ![]() |
0.360 | D00VZZ | ![]() |
0.303 | ||
| ENC003219 | ![]() |
0.350 | D0B4RU | ![]() |
0.291 | ||
| ENC004411 | ![]() |
0.343 | D0X7XG | ![]() |
0.283 | ||
| ENC004410 | ![]() |
0.343 | D09NNA | ![]() |
0.282 | ||
| ENC003050 | ![]() |
0.337 | D04SFH | ![]() |
0.281 | ||
| ENC000609 | ![]() |
0.336 | D0KR5B | ![]() |
0.274 | ||