|
Name |
Desmethyldichlorodiaportintone
|
| Molecular Formula | C15H12Cl2O7 | |
| IUPAC Name* |
3-[[(2R,4R)-2-(dichloromethyl)-4-hydroxy-5-oxooxolan-2-yl]methyl]-6,8-dihydroxyisochromen-1-one
|
|
| SMILES |
C1[C@H](C(=O)O[C@]1(CC2=CC3=CC(=CC(=C3C(=O)O2)O)O)C(Cl)Cl)O
|
|
| InChI |
InChI=1S/C15H12Cl2O7/c16-14(17)15(5-10(20)12(21)24-15)4-8-2-6-1-7(18)3-9(19)11(6)13(22)23-8/h1-3,10,14,18-20H,4-5H2/t10-,15+/m1/s1
|
|
| InChIKey |
WLSIGSTXXIHFIZ-BMIGLBTASA-N
|
|
| Synonyms |
Desmethyldichlorodiaportintone
|
|
| CAS | NA | |
| PubChem CID | 139590572 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 375.2 | ALogp: | 2.7 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 113.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.556 |
| Caco-2 Permeability: | -5.307 | MDCK Permeability: | 0.00012644 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.993 |
| Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.025 |
| 30% Bioavailability (F30%): | 0.078 |
| Blood-Brain-Barrier Penetration (BBB): | 0.104 | Plasma Protein Binding (PPB): | 89.91% |
| Volume Distribution (VD): | 0.936 | Fu: | 12.98% |
| CYP1A2-inhibitor: | 0.132 | CYP1A2-substrate: | 0.971 |
| CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.33 |
| CYP2C9-inhibitor: | 0.055 | CYP2C9-substrate: | 0.309 |
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.255 |
| CYP3A4-inhibitor: | 0.136 | CYP3A4-substrate: | 0.125 |
| Clearance (CL): | 9.253 | Half-life (T1/2): | 0.904 |
| hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.278 |
| Drug-inuced Liver Injury (DILI): | 0.555 | AMES Toxicity: | 0.076 |
| Rat Oral Acute Toxicity: | 0.305 | Maximum Recommended Daily Dose: | 0.418 |
| Skin Sensitization: | 0.369 | Carcinogencity: | 0.569 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.15 |
| Respiratory Toxicity: | 0.87 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003881 | ![]() |
0.797 | D04AIT | ![]() |
0.295 | ||
| ENC005210 | ![]() |
0.797 | D0K8KX | ![]() |
0.289 | ||
| ENC002509 | ![]() |
0.568 | D07MGA | ![]() |
0.273 | ||
| ENC001951 | ![]() |
0.536 | D07EXH | ![]() |
0.219 | ||
| ENC001569 | ![]() |
0.521 | D0AZ8C | ![]() |
0.216 | ||
| ENC004556 | ![]() |
0.521 | D06GCK | ![]() |
0.207 | ||
| ENC002320 | ![]() |
0.488 | D02UFG | ![]() |
0.207 | ||
| ENC004995 | ![]() |
0.488 | D0FA2O | ![]() |
0.204 | ||
| ENC005393 | ![]() |
0.481 | D0R6BI | ![]() |
0.204 | ||
| ENC003883 | ![]() |
0.475 | D02TJS | ![]() |
0.204 | ||