|
Name |
[(2S,3S,5S,10R,11S,12S,13S,17S)-12-acetyloxy-2,11-dihydroxy-4,4,10,13-tetramethyl-17-[(2S)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate
|
| Molecular Formula | C34H52O6 | |
| IUPAC Name* |
[(2S,3S,5S,10R,11S,12S,13S,17S)-12-acetyloxy-2,11-dihydroxy-4,4,10,13-tetramethyl-17-[(2S)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate
|
|
| SMILES |
C[C@@H](CCC(=C)C(C)C)[C@@H]1CC=C2[C@]1([C@@H]([C@H](C3=C2CC[C@H]4[C@]3(C[C@@H]([C@H](C4(C)C)OC(=O)C)O)C)O)OC(=O)C)C
|
|
| InChI |
InChI=1S/C34H52O6/c1-18(2)19(3)11-12-20(4)24-14-15-25-23-13-16-27-32(7,8)30(39-21(5)35)26(37)17-33(27,9)28(23)29(38)31(34(24,25)10)40-22(6)36/h15,18,20,24,26-27,29-31,37-38H,3,11-14,16-17H2,1-2,4-10H3/t20-,24-,26-,27+,29-,30+,31+,33+,34-/m0/s1
|
|
| InChIKey |
GTJJCCFMWDWZHD-MHNSYPGMSA-N
|
|
| Synonyms |
Integracide F
|
|
| CAS | NA | |
| PubChem CID | 139587717 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 556.8 | ALogp: | 6.2 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 93.1 | Aromatic Rings: | 4 |
| Heavy Atoms: | 40 | QED Weighted: | 0.282 |
| Caco-2 Permeability: | -4.91 | MDCK Permeability: | 0.00001960 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0.864 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.932 |
| 30% Bioavailability (F30%): | 0.563 |
| Blood-Brain-Barrier Penetration (BBB): | 0.353 | Plasma Protein Binding (PPB): | 92.80% |
| Volume Distribution (VD): | 1.479 | Fu: | 5.10% |
| CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.061 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.49 |
| CYP2C9-inhibitor: | 0.083 | CYP2C9-substrate: | 0.062 |
| CYP2D6-inhibitor: | 0.466 | CYP2D6-substrate: | 0.056 |
| CYP3A4-inhibitor: | 0.809 | CYP3A4-substrate: | 0.671 |
| Clearance (CL): | 3.753 | Half-life (T1/2): | 0.019 |
| hERG Blockers: | 0.74 | Human Hepatotoxicity (H-HT): | 0.288 |
| Drug-inuced Liver Injury (DILI): | 0.519 | AMES Toxicity: | 0.024 |
| Rat Oral Acute Toxicity: | 0.921 | Maximum Recommended Daily Dose: | 0.921 |
| Skin Sensitization: | 0.384 | Carcinogencity: | 0.797 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.982 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003485 | ![]() |
0.833 | D0X7XG | ![]() |
0.297 | ||
| ENC003486 | ![]() |
0.821 | D0H2MO | ![]() |
0.297 | ||
| ENC001119 | ![]() |
0.821 | D0Y7LD | ![]() |
0.252 | ||
| ENC003487 | ![]() |
0.783 | D03ZTE | ![]() |
0.245 | ||
| ENC002075 | ![]() |
0.391 | D0G3SH | ![]() |
0.245 | ||
| ENC005630 | ![]() |
0.357 | D08BDT | ![]() |
0.244 | ||
| ENC002119 | ![]() |
0.338 | D09WYX | ![]() |
0.244 | ||
| ENC006069 | ![]() |
0.338 | D0OR2L | ![]() |
0.242 | ||
| ENC002718 | ![]() |
0.333 | D0M4WA | ![]() |
0.237 | ||
| ENC005968 | ![]() |
0.329 | D0G7KJ | ![]() |
0.236 | ||