|
Name |
(1R,5R,6R,7R,9S,11S,13S,14R)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol
|
| Molecular Formula | C11H17N3O8 | |
| IUPAC Name* |
(1R,5R,6R,7R,9S,11S,13S,14R)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol
|
|
| SMILES |
C([C@]1([C@H]2[C@@H]3[C@H](N=C(N[C@]34[C@@H]([C@](O2)(O[C@H]1C4O)O)O)N)O)O)O
|
|
| InChI |
InChI=1S/C11H17N3O8/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5/h2-7,15-20H,1H2,(H3,12,13,14)/t2-,3?,4-,5+,6-,7+,9-,10-,11+/m1/s1
|
|
| InChIKey |
CFMYXEVWODSLAX-DSCPYQGSSA-N
|
|
| Synonyms |
TETRODOTOXIN
|
|
| CAS | 4368-28-9 | |
| PubChem CID | 139251219 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 319.27 | ALogp: | -5.9 |
| HBD: | 8 | HBA: | 9 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 190.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 22 | QED Weighted: | 0.204 |
| Caco-2 Permeability: | -6.27 | MDCK Permeability: | 0.00008130 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.997 |
| Human Intestinal Absorption (HIA): | 0.855 | 20% Bioavailability (F20%): | 0.91 |
| 30% Bioavailability (F30%): | 0.974 |
| Blood-Brain-Barrier Penetration (BBB): | 0.077 | Plasma Protein Binding (PPB): | 15.37% |
| Volume Distribution (VD): | 0.368 | Fu: | 81.93% |
| CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.056 |
| CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.063 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.023 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.162 |
| CYP3A4-inhibitor: | 0.004 | CYP3A4-substrate: | 0.012 |
| Clearance (CL): | 1.545 | Half-life (T1/2): | 0.654 |
| hERG Blockers: | 0.066 | Human Hepatotoxicity (H-HT): | 0.072 |
| Drug-inuced Liver Injury (DILI): | 0.184 | AMES Toxicity: | 0.285 |
| Rat Oral Acute Toxicity: | 0.005 | Maximum Recommended Daily Dose: | 0.002 |
| Skin Sensitization: | 0.14 | Carcinogencity: | 0.021 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.807 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003363 | ![]() |
0.232 | D0C7ET | ![]() |
1.000 | ||
| ENC000661 | ![]() |
0.216 | D0T5BC | ![]() |
0.247 | ||
| ENC005895 | ![]() |
0.211 | D04ZTY | ![]() |
0.218 | ||
| ENC004291 | ![]() |
0.211 | D0H3KI | ![]() |
0.216 | ||
| ENC004325 | ![]() |
0.200 | D07NSU | ![]() |
0.216 | ||
| ENC004327 | ![]() |
0.187 | D0H2RI | ![]() |
0.200 | ||
| ENC004329 | ![]() |
0.187 | D0MU9L | ![]() |
0.189 | ||
| ENC003598 | ![]() |
0.187 | D0Z4EI | ![]() |
0.189 | ||
| ENC002977 | ![]() |
0.187 | D0AR3J | ![]() |
0.188 | ||
| ENC003068 | ![]() |
0.185 | D02HYK | ![]() |
0.185 | ||