![]() |
Name |
(8e,12z)-10,11-Dihydroxyoctadeca-8,12-dienoic acid
|
Molecular Formula | C18H32O4 | |
IUPAC Name* |
(8E,12Z)-10,11-dihydroxyoctadeca-8,12-dienoic acid
|
|
SMILES |
CCCCC/C=C\C(C(/C=C/CCCCCCC(=O)O)O)O
|
|
InChI |
InChI=1S/C18H32O4/c1-2-3-4-7-10-13-16(19)17(20)14-11-8-5-6-9-12-15-18(21)22/h10-11,13-14,16-17,19-20H,2-9,12,15H2,1H3,(H,21,22)/b13-10-,14-11+
|
|
InChIKey |
GJGSSMGEAZMVTN-FXYWYECCSA-N
|
|
Synonyms |
(8e,12z)-10,11-dihydroxyoctadeca-8,12-dienoic acid
|
|
CAS | NA | |
PubChem CID | 138393168 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 312.4 | ALogp: | 4.1 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 14 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 0 |
Heavy Atoms: | 22 | QED Weighted: | 0.326 |
Caco-2 Permeability: | -5.38 | MDCK Permeability: | 0.00006110 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.884 | 20% Bioavailability (F20%): | 0.999 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.077 | Plasma Protein Binding (PPB): | 98.51% |
Volume Distribution (VD): | 0.364 | Fu: | 1.37% |
CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.339 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.274 |
CYP2C9-inhibitor: | 0.056 | CYP2C9-substrate: | 0.993 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.365 |
CYP3A4-inhibitor: | 0.014 | CYP3A4-substrate: | 0.021 |
Clearance (CL): | 1.979 | Half-life (T1/2): | 0.898 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.442 |
Drug-inuced Liver Injury (DILI): | 0.033 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.12 | Maximum Recommended Daily Dose: | 0.046 |
Skin Sensitization: | 0.652 | Carcinogencity: | 0.039 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.025 |
Respiratory Toxicity: | 0.482 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004759 | ![]() |
1.000 | D0O1TC | ![]() |
0.570 | ||
ENC001554 | ![]() |
0.631 | D0UE9X | ![]() |
0.532 | ||
ENC001099 | ![]() |
0.623 | D0O1PH | ![]() |
0.530 | ||
ENC001589 | ![]() |
0.623 | D0I4DQ | ![]() |
0.444 | ||
ENC001535 | ![]() |
0.616 | D0Z5BC | ![]() |
0.426 | ||
ENC001584 | ![]() |
0.616 | D09SRR | ![]() |
0.417 | ||
ENC001594 | ![]() |
0.616 | D06FEA | ![]() |
0.413 | ||
ENC001595 | ![]() |
0.616 | D0OR6A | ![]() |
0.406 | ||
ENC001544 | ![]() |
0.616 | D0XN8C | ![]() |
0.395 | ||
ENC002562 | ![]() |
0.605 | D04RGA | ![]() |
0.364 |