![]() |
Name |
spiropreussione B
|
Molecular Formula | C29H16O6 | |
IUPAC Name* |
8',16'-dihydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,3'-pentacyclo[9.7.1.02,9.04,8.015,19]nonadeca-1(19),2(9),6,10,12,15,17-heptaene]-5',14'-dione
|
|
SMILES |
C1=CC2=C3C(=C1)OC4(C5C(=O)C=CC5(C6=C4C7=C8C(=C6)C=CC(=O)C8=C(C=C7)O)O)OC3=CC=C2
|
|
InChI |
InChI=1S/C29H16O6/c30-18-9-7-15-13-17-26(16-8-10-19(31)25(18)23(15)16)29(27-20(32)11-12-28(17,27)33)34-21-5-1-3-14-4-2-6-22(35-29)24(14)21/h1-13,27,31,33H
|
|
InChIKey |
FILDGUAQQYKJCM-UHFFFAOYSA-N
|
|
Synonyms |
spiropreussione B; CHEMBL1078017
|
|
CAS | 1187303-47-4 | |
PubChem CID | 137629493 | |
ChEMBL ID | CHEMBL1078017 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 460.4 | ALogp: | 4.6 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 8 |
Heavy Atoms: | 35 | QED Weighted: | 0.384 |
Caco-2 Permeability: | -5.164 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.061 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.351 |
Blood-Brain-Barrier Penetration (BBB): | 0.011 | Plasma Protein Binding (PPB): | 99.56% |
Volume Distribution (VD): | 0.235 | Fu: | 0.83% |
CYP1A2-inhibitor: | 0.447 | CYP1A2-substrate: | 0.529 |
CYP2C19-inhibitor: | 0.856 | CYP2C19-substrate: | 0.068 |
CYP2C9-inhibitor: | 0.923 | CYP2C9-substrate: | 0.933 |
CYP2D6-inhibitor: | 0.916 | CYP2D6-substrate: | 0.111 |
CYP3A4-inhibitor: | 0.852 | CYP3A4-substrate: | 0.372 |
Clearance (CL): | 1.479 | Half-life (T1/2): | 0.113 |
hERG Blockers: | 0.097 | Human Hepatotoxicity (H-HT): | 0.815 |
Drug-inuced Liver Injury (DILI): | 0.947 | AMES Toxicity: | 0.861 |
Rat Oral Acute Toxicity: | 0.978 | Maximum Recommended Daily Dose: | 0.963 |
Skin Sensitization: | 0.918 | Carcinogencity: | 0.97 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.896 |
Respiratory Toxicity: | 0.861 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000996 | ![]() |
0.513 | D06TJJ | ![]() |
0.301 | ||
ENC002038 | ![]() |
0.496 | D02TJS | ![]() |
0.246 | ||
ENC005722 | ![]() |
0.479 | D08PCE | ![]() |
0.246 | ||
ENC005549 | ![]() |
0.479 | D00PEH | ![]() |
0.245 | ||
ENC005548 | ![]() |
0.466 | D0V9WF | ![]() |
0.241 | ||
ENC003202 | ![]() |
0.456 | D07NVU | ![]() |
0.236 | ||
ENC003200 | ![]() |
0.456 | D0G7IY | ![]() |
0.233 | ||
ENC002530 | ![]() |
0.454 | D0AZ8C | ![]() |
0.228 | ||
ENC003201 | ![]() |
0.452 | D02ZTJ | ![]() |
0.224 | ||
ENC003199 | ![]() |
0.442 | D0Q5UQ | ![]() |
0.223 |