![]() |
Name |
Pestalotioprolide G
|
Molecular Formula | C14H20O4 | |
IUPAC Name* |
(6Z,8E,10R,14S)-10-hydroxy-14-methyl-1-oxacyclotetradeca-6,8-diene-2,5-dione
|
|
SMILES |
C[C@H]1CCC[C@H](/C=C/C=C\C(=O)CCC(=O)O1)O
|
|
InChI |
InChI=1S/C14H20O4/c1-11-5-4-8-12(15)6-2-3-7-13(16)9-10-14(17)18-11/h2-3,6-7,11-12,15H,4-5,8-10H2,1H3/b6-2+,7-3-/t11-,12-/m0/s1
|
|
InChIKey |
YZNVCTMDYKESIP-PSNQXOFWSA-N
|
|
Synonyms |
Pestalotioprolide G; CHEMBL3966477
|
|
CAS | NA | |
PubChem CID | 134150789 | |
ChEMBL ID | CHEMBL3966477 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.31 | ALogp: | 1.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.673 |
Caco-2 Permeability: | -4.539 | MDCK Permeability: | 0.00003790 |
Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.029 |
30% Bioavailability (F30%): | 0.724 |
Blood-Brain-Barrier Penetration (BBB): | 0.99 | Plasma Protein Binding (PPB): | 65.02% |
Volume Distribution (VD): | 0.321 | Fu: | 39.02% |
CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.098 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.837 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.617 |
CYP3A4-inhibitor: | 0.074 | CYP3A4-substrate: | 0.211 |
Clearance (CL): | 8.808 | Half-life (T1/2): | 0.934 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.391 |
Drug-inuced Liver Injury (DILI): | 0.271 | AMES Toxicity: | 0.952 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.924 |
Skin Sensitization: | 0.94 | Carcinogencity: | 0.902 |
Eye Corrosion: | 0.825 | Eye Irritation: | 0.427 |
Respiratory Toxicity: | 0.347 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003473 | ![]() |
0.746 | D0C7JF | ![]() |
0.273 | ||
ENC003836 | ![]() |
0.561 | D0M5RF | ![]() |
0.250 | ||
ENC003465 | ![]() |
0.515 | D0F1UL | ![]() |
0.239 | ||
ENC003467 | ![]() |
0.515 | D0D2VS | ![]() |
0.233 | ||
ENC001414 | ![]() |
0.449 | D00YWP | ![]() |
0.230 | ||
ENC001860 | ![]() |
0.395 | D00ZFP | ![]() |
0.230 | ||
ENC004080 | ![]() |
0.394 | D07GRH | ![]() |
0.227 | ||
ENC004081 | ![]() |
0.394 | D06XMU | ![]() |
0.225 | ||
ENC002164 | ![]() |
0.391 | D0K7LU | ![]() |
0.222 | ||
ENC002181 | ![]() |
0.391 | D0D1SG | ![]() |
0.222 |