|
Name |
(-)-(10E,15S)-4,6-dichloro-10(11)-dehydrocurvularin
|
| Molecular Formula | C16H16Cl2O5 | |
| IUPAC Name* |
(5S,9E)-14,16-dichloro-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione
|
|
| SMILES |
C[C@H]1CCC/C=C/C(=O)C2=C(CC(=O)O1)C(=C(C(=C2O)Cl)O)Cl
|
|
| InChI |
InChI=1S/C16H16Cl2O5/c1-8-5-3-2-4-6-10(19)12-9(7-11(20)23-8)13(17)16(22)14(18)15(12)21/h4,6,8,21-22H,2-3,5,7H2,1H3/b6-4+/t8-/m0/s1
|
|
| InChIKey |
QEYDBBDMWLUESL-JQTRYQTASA-N
|
|
| Synonyms |
CHEMBL4078658; BDBM50514005; J3.515.215F; (-)-(10E,15S)-4,6-dichloro-10(11)-dehydrocurvularin; (8S)-1,3-Dihydroxy-2,4-dichloro-8beta-methyl-5,6,9,10,11,14-hexahydro-8H-7-oxabenzocyclododecene-6,14-dione
|
|
| CAS | NA | |
| PubChem CID | 132561319 | |
| ChEMBL ID | CHEMBL4078658 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 359.2 | ALogp: | 4.3 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 23 | QED Weighted: | 0.668 |
| Caco-2 Permeability: | -4.75 | MDCK Permeability: | 0.00002960 |
| Pgp-inhibitor: | 0.05 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.008 |
| Blood-Brain-Barrier Penetration (BBB): | 0.3 | Plasma Protein Binding (PPB): | 99.14% |
| Volume Distribution (VD): | 0.63 | Fu: | 1.65% |
| CYP1A2-inhibitor: | 0.626 | CYP1A2-substrate: | 0.132 |
| CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.075 |
| CYP2C9-inhibitor: | 0.723 | CYP2C9-substrate: | 0.95 |
| CYP2D6-inhibitor: | 0.062 | CYP2D6-substrate: | 0.184 |
| CYP3A4-inhibitor: | 0.212 | CYP3A4-substrate: | 0.16 |
| Clearance (CL): | 10.851 | Half-life (T1/2): | 0.587 |
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.142 |
| Drug-inuced Liver Injury (DILI): | 0.923 | AMES Toxicity: | 0.046 |
| Rat Oral Acute Toxicity: | 0.12 | Maximum Recommended Daily Dose: | 0.624 |
| Skin Sensitization: | 0.493 | Carcinogencity: | 0.884 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.207 |
| Respiratory Toxicity: | 0.893 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005418 | ![]() |
0.694 | D0R6BI | ![]() |
0.235 | ||
| ENC005643 | ![]() |
0.579 | D0ZX2G | ![]() |
0.232 | ||
| ENC001849 | ![]() |
0.579 | D0D0GV | ![]() |
0.226 | ||
| ENC002286 | ![]() |
0.579 | D01XDL | ![]() |
0.221 | ||
| ENC002287 | ![]() |
0.579 | D0C1SF | ![]() |
0.221 | ||
| ENC005419 | ![]() |
0.579 | D0K7LU | ![]() |
0.220 | ||
| ENC005417 | ![]() |
0.579 | D07MGA | ![]() |
0.218 | ||
| ENC005706 | ![]() |
0.486 | D06ZEE | ![]() |
0.214 | ||
| ENC004730 | ![]() |
0.422 | D01XWG | ![]() |
0.213 | ||
| ENC005138 | ![]() |
0.419 | D07VLY | ![]() |
0.209 | ||