|
Name |
methyl (4aR,7aR)-7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
|
| Molecular Formula | C17H24O10 | |
| IUPAC Name* |
methyl (4aR,7aR)-7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
|
|
| SMILES |
COC(=O)C1=COC([C@@H]2[C@H]1CC=C2CO)OC3C(C(C(C(O3)CO)O)O)O
|
|
| InChI |
InChI=1S/C17H24O10/c1-24-15(23)9-6-25-16(11-7(4-18)2-3-8(9)11)27-17-14(22)13(21)12(20)10(5-19)26-17/h2,6,8,10-14,16-22H,3-5H2,1H3/t8-,10?,11-,12?,13?,14?,16?,17?/m0/s1
|
|
| InChIKey |
IBFYXTRXDNAPMM-YFAICUPXSA-N
|
|
| Synonyms |
Geniposide; 24512-63-8
|
|
| CAS | 24512-63-8 | |
| PubChem CID | 129316837 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 388.4 | ALogp: | -2.3 |
| HBD: | 5 | HBA: | 10 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 155.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 27 | QED Weighted: | 0.274 |
| Caco-2 Permeability: | -5.657 | MDCK Permeability: | 0.00015361 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.016 |
| Human Intestinal Absorption (HIA): | 0.893 | 20% Bioavailability (F20%): | 0.464 |
| 30% Bioavailability (F30%): | 0.992 |
| Blood-Brain-Barrier Penetration (BBB): | 0.452 | Plasma Protein Binding (PPB): | 26.70% |
| Volume Distribution (VD): | 0.295 | Fu: | 59.36% |
| CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.056 |
| CYP2C19-inhibitor: | 0.009 | CYP2C19-substrate: | 0.19 |
| CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.046 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.097 |
| CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.083 |
| Clearance (CL): | 1.52 | Half-life (T1/2): | 0.84 |
| hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.196 |
| Drug-inuced Liver Injury (DILI): | 0.964 | AMES Toxicity: | 0.255 |
| Rat Oral Acute Toxicity: | 0.227 | Maximum Recommended Daily Dose: | 0.278 |
| Skin Sensitization: | 0.039 | Carcinogencity: | 0.936 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.508 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004291 | ![]() |
0.413 | D06BQU | ![]() |
0.402 | ||
| ENC001567 | ![]() |
0.390 | D0T5BC | ![]() |
0.388 | ||
| ENC001062 | ![]() |
0.388 | D02HYK | ![]() |
0.336 | ||
| ENC003068 | ![]() |
0.388 | D0H3KI | ![]() |
0.329 | ||
| ENC001625 | ![]() |
0.374 | D0YV1Q | ![]() |
0.328 | ||
| ENC000851 | ![]() |
0.360 | D05ZYM | ![]() |
0.314 | ||
| ENC002949 | ![]() |
0.347 | D0S0NK | ![]() |
0.313 | ||
| ENC005772 | ![]() |
0.340 | D0Y3MO | ![]() |
0.312 | ||
| ENC005608 | ![]() |
0.340 | D07BCT | ![]() |
0.301 | ||
| ENC003397 | ![]() |
0.336 | D07JPC | ![]() |
0.292 | ||