![]() |
Name |
(+/-)-Penifupyrone
|
Molecular Formula | C19H18O8 | |
IUPAC Name* |
methyl 3,5-dimethoxy-2-(5-methyl-7-oxo-5,6-dihydrofuro[3,2-b]pyran-3-carbonyl)benzoate
|
|
SMILES |
CC1CC(=O)C2=C(O1)C(=CO2)C(=O)C3=C(C=C(C=C3OC)OC)C(=O)OC
|
|
InChI |
InChI=1S/C19H18O8/c1-9-5-13(20)18-17(27-9)12(8-26-18)16(21)15-11(19(22)25-4)6-10(23-2)7-14(15)24-3/h6-9H,5H2,1-4H3
|
|
InChIKey |
BLDKOKNYBYRQGV-UHFFFAOYSA-N
|
|
Synonyms |
CHEMBL3593570; (+/-)-penifupyrone; BDBM50104669
|
|
CAS | NA | |
PubChem CID | 122182016 | |
ChEMBL ID | CHEMBL3593570 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 374.3 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 8 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 101.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 27 | QED Weighted: | 0.579 |
Caco-2 Permeability: | -4.574 | MDCK Permeability: | 0.00005790 |
Pgp-inhibitor: | 0.929 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.138 |
Blood-Brain-Barrier Penetration (BBB): | 0.138 | Plasma Protein Binding (PPB): | 73.08% |
Volume Distribution (VD): | 0.658 | Fu: | 12.64% |
CYP1A2-inhibitor: | 0.848 | CYP1A2-substrate: | 0.88 |
CYP2C19-inhibitor: | 0.92 | CYP2C19-substrate: | 0.131 |
CYP2C9-inhibitor: | 0.863 | CYP2C9-substrate: | 0.809 |
CYP2D6-inhibitor: | 0.607 | CYP2D6-substrate: | 0.67 |
CYP3A4-inhibitor: | 0.818 | CYP3A4-substrate: | 0.207 |
Clearance (CL): | 11.696 | Half-life (T1/2): | 0.291 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.403 |
Drug-inuced Liver Injury (DILI): | 0.947 | AMES Toxicity: | 0.123 |
Rat Oral Acute Toxicity: | 0.751 | Maximum Recommended Daily Dose: | 0.614 |
Skin Sensitization: | 0.059 | Carcinogencity: | 0.825 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.031 |
Respiratory Toxicity: | 0.864 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003039 | ![]() |
0.615 | D0C1SF | ![]() |
0.324 | ||
ENC001897 | ![]() |
0.611 | D09DHY | ![]() |
0.283 | ||
ENC002043 | ![]() |
0.596 | D0F7CS | ![]() |
0.279 | ||
ENC003306 | ![]() |
0.531 | D04TDQ | ![]() |
0.272 | ||
ENC005979 | ![]() |
0.516 | D02LZB | ![]() |
0.263 | ||
ENC004806 | ![]() |
0.484 | D0G4KG | ![]() |
0.257 | ||
ENC004340 | ![]() |
0.439 | D06GCK | ![]() |
0.254 | ||
ENC005978 | ![]() |
0.439 | D01FFA | ![]() |
0.254 | ||
ENC002468 | ![]() |
0.439 | D06TQZ | ![]() |
0.252 | ||
ENC002663 | ![]() |
0.398 | D0L1JW | ![]() |
0.252 |