![]() |
Name |
3-O-desmethyl-phomentrioloxin
|
Molecular Formula | C16H22O4 | |
IUPAC Name* |
(1R,2R,3R,4R)-5-(7-methyl-3-methylideneoct-6-en-1-ynyl)cyclohex-5-ene-1,2,3,4-tetrol
|
|
SMILES |
CC(=CCCC(=C)C#CC1=C[C@H]([C@H]([C@@H]([C@@H]1O)O)O)O)C
|
|
InChI |
InChI=1S/C16H22O4/c1-10(2)5-4-6-11(3)7-8-12-9-13(17)15(19)16(20)14(12)18/h5,9,13-20H,3-4,6H2,1-2H3/t13-,14-,15-,16-/m1/s1
|
|
InChIKey |
XXKZDPIKARAWFU-KLHDSHLOSA-N
|
|
Synonyms |
3-O-desmethyl-phomentrioloxin; 3-O-Desmethylphomentrioloxin; J3.652.054J
|
|
CAS | NA | |
PubChem CID | 121233005 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.34 | ALogp: | 1.1 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 80.9 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.46 |
Caco-2 Permeability: | -5.15 | MDCK Permeability: | 0.00001120 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.582 |
Human Intestinal Absorption (HIA): | 0.739 | 20% Bioavailability (F20%): | 0.078 |
30% Bioavailability (F30%): | 0.421 |
Blood-Brain-Barrier Penetration (BBB): | 0.052 | Plasma Protein Binding (PPB): | 94.43% |
Volume Distribution (VD): | 1.944 | Fu: | 1.62% |
CYP1A2-inhibitor: | 0.078 | CYP1A2-substrate: | 0.044 |
CYP2C19-inhibitor: | 0.083 | CYP2C19-substrate: | 0.563 |
CYP2C9-inhibitor: | 0.195 | CYP2C9-substrate: | 0.864 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.074 |
CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.08 |
Clearance (CL): | 4.416 | Half-life (T1/2): | 0.754 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.805 |
Drug-inuced Liver Injury (DILI): | 0.906 | AMES Toxicity: | 0.503 |
Rat Oral Acute Toxicity: | 0.705 | Maximum Recommended Daily Dose: | 0.957 |
Skin Sensitization: | 0.957 | Carcinogencity: | 0.32 |
Eye Corrosion: | 0.01 | Eye Irritation: | 0.49 |
Respiratory Toxicity: | 0.971 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002872 | ![]() |
0.758 | D02HYK | ![]() |
0.245 | ||
ENC004551 | ![]() |
0.581 | D05ZYM | ![]() |
0.227 | ||
ENC004553 | ![]() |
0.542 | D0H3KI | ![]() |
0.217 | ||
ENC004558 | ![]() |
0.493 | D07HZY | ![]() |
0.215 | ||
ENC004552 | ![]() |
0.461 | D0HR8Z | ![]() |
0.208 | ||
ENC004554 | ![]() |
0.434 | D0X7XG | ![]() |
0.206 | ||
ENC002153 | ![]() |
0.400 | D0MU9L | ![]() |
0.206 | ||
ENC004557 | ![]() |
0.384 | D0H2RI | ![]() |
0.200 | ||
ENC004335 | ![]() |
0.333 | D07NSU | ![]() |
0.200 | ||
ENC004334 | ![]() |
0.333 | D0D0ZD | ![]() |
0.200 |