|
Name |
3-O-methyl-epimacowine
|
| Molecular Formula | C17H21NO3 | |
| IUPAC Name* |
(1S,10R,12S)-4,12-dimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6,13-tetraen-5-ol
|
|
| SMILES |
CO[C@H]1C[C@@H]2[C@@]3(CCN2CC4=CC(=C(C=C43)OC)O)C=C1
|
|
| InChI |
InChI=1S/C17H21NO3/c1-20-12-3-4-17-5-6-18(16(17)8-12)10-11-7-14(19)15(21-2)9-13(11)17/h3-4,7,9,12,16,19H,5-6,8,10H2,1-2H3/t12-,16-,17-/m1/s1
|
|
| InChIKey |
LJYZWRHUXSEXAW-CSMYWGQOSA-N
|
|
| Synonyms |
3-O-methyl-epimacowine
|
|
| CAS | NA | |
| PubChem CID | 102125340 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 287.35 | ALogp: | 2.0 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 41.9 | Aromatic Rings: | 4 |
| Heavy Atoms: | 21 | QED Weighted: | 0.849 |
| Caco-2 Permeability: | -4.677 | MDCK Permeability: | 0.00001650 |
| Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.914 |
| Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.932 |
| Blood-Brain-Barrier Penetration (BBB): | 0.99 | Plasma Protein Binding (PPB): | 29.47% |
| Volume Distribution (VD): | 2.735 | Fu: | 64.58% |
| CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.672 |
| CYP2C19-inhibitor: | 0.039 | CYP2C19-substrate: | 0.863 |
| CYP2C9-inhibitor: | 0.034 | CYP2C9-substrate: | 0.433 |
| CYP2D6-inhibitor: | 0.407 | CYP2D6-substrate: | 0.864 |
| CYP3A4-inhibitor: | 0.172 | CYP3A4-substrate: | 0.677 |
| Clearance (CL): | 15.509 | Half-life (T1/2): | 0.713 |
| hERG Blockers: | 0.258 | Human Hepatotoxicity (H-HT): | 0.433 |
| Drug-inuced Liver Injury (DILI): | 0.131 | AMES Toxicity: | 0.118 |
| Rat Oral Acute Toxicity: | 0.383 | Maximum Recommended Daily Dose: | 0.934 |
| Skin Sensitization: | 0.117 | Carcinogencity: | 0.822 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.882 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001089 | ![]() |
0.425 | D0R9VR | ![]() |
0.395 | ||
| ENC002961 | ![]() |
0.404 | D0J4IX | ![]() |
0.284 | ||
| ENC001059 | ![]() |
0.283 | D03DIG | ![]() |
0.281 | ||
| ENC001367 | ![]() |
0.276 | D09PJX | ![]() |
0.278 | ||
| ENC001537 | ![]() |
0.269 | D01FFA | ![]() |
0.276 | ||
| ENC005762 | ![]() |
0.269 | D03SKD | ![]() |
0.263 | ||
| ENC003973 | ![]() |
0.266 | D09OBB | ![]() |
0.255 | ||
| ENC004159 | ![]() |
0.262 | D0T6RC | ![]() |
0.255 | ||
| ENC004160 | ![]() |
0.262 | D03XES | ![]() |
0.253 | ||
| ENC004161 | ![]() |
0.262 | D02DKD | ![]() |
0.250 | ||