![]() |
Name |
Phomopsolidone B
|
Molecular Formula | C15H22O6 | |
IUPAC Name* |
[(E,4S,5S)-4,5-dihydroxy-1-(5-oxooxolan-2-yl)hex-2-enyl] (E)-2-methylbut-2-enoate
|
|
SMILES |
C/C=C(\C)/C(=O)OC(/C=C/[C@@H]([C@H](C)O)O)C1CCC(=O)O1
|
|
InChI |
InChI=1S/C15H22O6/c1-4-9(2)15(19)21-13(6-5-11(17)10(3)16)12-7-8-14(18)20-12/h4-6,10-13,16-17H,7-8H2,1-3H3/b6-5+,9-4+/t10-,11-,12?,13?/m0/s1
|
|
InChIKey |
KDJQJYVWRNNMAM-AYRSGXSMSA-N
|
|
Synonyms |
Phomopsolidone B
|
|
CAS | NA | |
PubChem CID | 101876423 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 298.33 | ALogp: | 0.8 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.436 |
Caco-2 Permeability: | -4.821 | MDCK Permeability: | 0.00006960 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.976 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.803 | Plasma Protein Binding (PPB): | 76.11% |
Volume Distribution (VD): | 0.667 | Fu: | 15.28% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.106 |
CYP2C19-inhibitor: | 0.072 | CYP2C19-substrate: | 0.454 |
CYP2C9-inhibitor: | 0.036 | CYP2C9-substrate: | 0.583 |
CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.164 |
CYP3A4-inhibitor: | 0.148 | CYP3A4-substrate: | 0.265 |
Clearance (CL): | 3.681 | Half-life (T1/2): | 0.87 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.37 |
Drug-inuced Liver Injury (DILI): | 0.333 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.264 | Maximum Recommended Daily Dose: | 0.838 |
Skin Sensitization: | 0.139 | Carcinogencity: | 0.078 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.082 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003321 | ![]() |
1.000 | D0E9KA | ![]() |
0.200 | ||
ENC003191 | ![]() |
0.647 | D0ZI4H | ![]() |
0.195 | ||
ENC001863 | ![]() |
0.474 | D0S8LV | ![]() |
0.192 | ||
ENC005693 | ![]() |
0.341 | D02IIW | ![]() |
0.187 | ||
ENC001864 | ![]() |
0.333 | D05ZTH | ![]() |
0.185 | ||
ENC005820 | ![]() |
0.301 | D0N3NO | ![]() |
0.182 | ||
ENC005821 | ![]() |
0.301 | D0T8LY | ![]() |
0.173 | ||
ENC005692 | ![]() |
0.300 | D00NPP | ![]() |
0.172 | ||
ENC005531 | ![]() |
0.280 | D0Q4TK | ![]() |
0.171 | ||
ENC005196 | ![]() |
0.278 | D02RQU | ![]() |
0.171 |