![]() |
Name |
Cytosporin C
|
Molecular Formula | C17H26O5 | |
IUPAC Name* |
(1aR,2S,4aR,7R,8aS)-2,7-dihydroxy-6,6-dimethyl-3-pentyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-4-carbaldehyde
|
|
SMILES |
CCCCCC1=C([C@@H]2[C@@]3(C[C@H](C(O2)(C)C)O)[C@@H]([C@H]1O)O3)C=O
|
|
InChI |
InChI=1S/C17H26O5/c1-4-5-6-7-10-11(9-18)14-17(15(22-17)13(10)20)8-12(19)16(2,3)21-14/h9,12-15,19-20H,4-8H2,1-3H3/t12-,13+,14-,15-,17+/m1/s1
|
|
InChIKey |
HTCLXJMGGBVISX-YCCFLXJFSA-N
|
|
Synonyms |
Cytosporin C
|
|
CAS | NA | |
PubChem CID | 101693320 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 310.4 | ALogp: | 0.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.461 |
Caco-2 Permeability: | -4.956 | MDCK Permeability: | 0.00001640 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.979 |
Human Intestinal Absorption (HIA): | 0.555 | 20% Bioavailability (F20%): | 0.316 |
30% Bioavailability (F30%): | 0.488 |
Blood-Brain-Barrier Penetration (BBB): | 0.193 | Plasma Protein Binding (PPB): | 67.59% |
Volume Distribution (VD): | 1.918 | Fu: | 32.68% |
CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.122 |
CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.776 |
CYP2C9-inhibitor: | 0.037 | CYP2C9-substrate: | 0.083 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.217 |
CYP3A4-inhibitor: | 0.027 | CYP3A4-substrate: | 0.237 |
Clearance (CL): | 7.386 | Half-life (T1/2): | 0.282 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.839 |
Drug-inuced Liver Injury (DILI): | 0.127 | AMES Toxicity: | 0.814 |
Rat Oral Acute Toxicity: | 0.867 | Maximum Recommended Daily Dose: | 0.962 |
Skin Sensitization: | 0.795 | Carcinogencity: | 0.654 |
Eye Corrosion: | 0.337 | Eye Irritation: | 0.66 |
Respiratory Toxicity: | 0.981 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002060 | ![]() |
0.704 | D0P1FO | ![]() |
0.265 | ||
ENC001996 | ![]() |
0.644 | D00HCQ | ![]() |
0.231 | ||
ENC002511 | ![]() |
0.636 | D0L7AS | ![]() |
0.229 | ||
ENC004326 | ![]() |
0.636 | D0Y7IU | ![]() |
0.227 | ||
ENC003663 | ![]() |
0.595 | D04QNO | ![]() |
0.227 | ||
ENC002977 | ![]() |
0.542 | D03SXE | ![]() |
0.226 | ||
ENC004329 | ![]() |
0.542 | D0HR8Z | ![]() |
0.220 | ||
ENC004330 | ![]() |
0.540 | D04VIS | ![]() |
0.219 | ||
ENC004327 | ![]() |
0.524 | D0O1UZ | ![]() |
0.218 | ||
ENC003598 | ![]() |
0.524 | D0V0IX | ![]() |
0.215 |