|
Name |
Trichodermic acid B
|
| Molecular Formula | C19H28O4 | |
| IUPAC Name* |
(2E,4E)-5-[(1R,4S,4aS,6R,7S,8S,8aS)-4,7-dihydroxy-2,6,8-trimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoic acid
|
|
| SMILES |
C[C@@H]1C[C@@H]2[C@@H](C=C([C@@H]([C@H]2[C@@H]([C@H]1O)C)/C=C/C=C(\C)/C(=O)O)C)O
|
|
| InChI |
InChI=1S/C19H28O4/c1-10(19(22)23)6-5-7-14-11(2)9-16(20)15-8-12(3)18(21)13(4)17(14)15/h5-7,9,12-18,20-21H,8H2,1-4H3,(H,22,23)/b7-5+,10-6+/t12-,13+,14+,15-,16-,17-,18+/m1/s1
|
|
| InChIKey |
JHSQFDKHGZYBKL-PQJKADKUSA-N
|
|
| Synonyms |
Tricodermic acid B; Trichodermic acid B
|
|
| CAS | NA | |
| PubChem CID | 101583710 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 320.4 | ALogp: | 2.6 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 77.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 23 | QED Weighted: | 0.422 |
| Caco-2 Permeability: | -4.836 | MDCK Permeability: | 0.00004240 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.386 |
| Human Intestinal Absorption (HIA): | 0.706 | 20% Bioavailability (F20%): | 0.008 |
| 30% Bioavailability (F30%): | 0.027 |
| Blood-Brain-Barrier Penetration (BBB): | 0.708 | Plasma Protein Binding (PPB): | 83.02% |
| Volume Distribution (VD): | 0.685 | Fu: | 10.59% |
| CYP1A2-inhibitor: | 0.125 | CYP1A2-substrate: | 0.222 |
| CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.611 |
| CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.155 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.131 |
| CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.19 |
| Clearance (CL): | 3.92 | Half-life (T1/2): | 0.892 |
| hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.736 |
| Drug-inuced Liver Injury (DILI): | 0.758 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.826 | Maximum Recommended Daily Dose: | 0.144 |
| Skin Sensitization: | 0.249 | Carcinogencity: | 0.49 |
| Eye Corrosion: | 0.008 | Eye Irritation: | 0.106 |
| Respiratory Toxicity: | 0.962 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006078 | ![]() |
0.610 | D0E9KA | ![]() |
0.254 | ||
| ENC006079 | ![]() |
0.579 | D02HYK | ![]() |
0.226 | ||
| ENC003166 | ![]() |
0.500 | D0X7XG | ![]() |
0.221 | ||
| ENC006077 | ![]() |
0.452 | D0W2EK | ![]() |
0.211 | ||
| ENC002015 | ![]() |
0.355 | D04SFH | ![]() |
0.206 | ||
| ENC004696 | ![]() |
0.326 | D0M4WA | ![]() |
0.202 | ||
| ENC004701 | ![]() |
0.313 | D0R0ZL | ![]() |
0.198 | ||
| ENC003385 | ![]() |
0.302 | D0Q0EX | ![]() |
0.198 | ||
| ENC003119 | ![]() |
0.280 | D05ZTH | ![]() |
0.198 | ||
| ENC004697 | ![]() |
0.267 | D06WTZ | ![]() |
0.195 | ||