|
Name |
Neocitreoviridinol
|
| Molecular Formula | C23H30O7 | |
| IUPAC Name* |
6-[(1E,3E,5E,7S)-7-hydroxy-7-[(1R,3S,4R,6R,7R)-7-hydroxy-1,4,6-trimethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]octa-1,3,5-trienyl]-4-methoxy-5-methylpyran-2-one
|
|
| SMILES |
C[C@@H]1[C@]2([C@H]([C@@](O1)([C@@H](O2)[C@](C)(/C=C/C=C/C=C/C3=C(C(=CC(=O)O3)OC)C)O)C)O)C
|
|
| InChI |
InChI=1S/C23H30O7/c1-14-16(28-18(24)13-17(14)27-6)11-9-7-8-10-12-21(3,26)20-23(5)19(25)22(4,30-20)15(2)29-23/h7-13,15,19-20,25-26H,1-6H3/b8-7+,11-9+,12-10+/t15-,19-,20+,21+,22+,23-/m1/s1
|
|
| InChIKey |
RCRXLARTQDULRN-KBMXKRJCSA-N
|
|
| Synonyms |
Neocitreoviridinol; 100905-90-6
|
|
| CAS | NA | |
| PubChem CID | 101283365 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 418.5 | ALogp: | 1.3 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
| Heavy Atoms: | 30 | QED Weighted: | 0.684 |
| Caco-2 Permeability: | -4.691 | MDCK Permeability: | 0.00001290 |
| Pgp-inhibitor: | 0.187 | Pgp-substrate: | 0.203 |
| Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.026 |
| 30% Bioavailability (F30%): | 0.095 |
| Blood-Brain-Barrier Penetration (BBB): | 0.306 | Plasma Protein Binding (PPB): | 74.41% |
| Volume Distribution (VD): | 0.941 | Fu: | 15.90% |
| CYP1A2-inhibitor: | 0.214 | CYP1A2-substrate: | 0.97 |
| CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.81 |
| CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.186 |
| CYP2D6-inhibitor: | 0.657 | CYP2D6-substrate: | 0.785 |
| CYP3A4-inhibitor: | 0.885 | CYP3A4-substrate: | 0.289 |
| Clearance (CL): | 2.927 | Half-life (T1/2): | 0.752 |
| hERG Blockers: | 0.565 | Human Hepatotoxicity (H-HT): | 0.99 |
| Drug-inuced Liver Injury (DILI): | 0.963 | AMES Toxicity: | 0.705 |
| Rat Oral Acute Toxicity: | 0.906 | Maximum Recommended Daily Dose: | 0.974 |
| Skin Sensitization: | 0.83 | Carcinogencity: | 0.084 |
| Eye Corrosion: | 0.012 | Eye Irritation: | 0.031 |
| Respiratory Toxicity: | 0.972 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005994 | ![]() |
0.705 | D05QDC | ![]() |
0.261 | ||
| ENC005765 | ![]() |
0.663 | D0B1IP | ![]() |
0.238 | ||
| ENC005764 | ![]() |
0.663 | D0FG6M | ![]() |
0.211 | ||
| ENC001850 | ![]() |
0.538 | D0Q0PR | ![]() |
0.198 | ||
| ENC005399 | ![]() |
0.450 | D0W2EK | ![]() |
0.190 | ||
| ENC005400 | ![]() |
0.433 | D0E9KA | ![]() |
0.190 | ||
| ENC003443 | ![]() |
0.373 | D06TQZ | ![]() |
0.180 | ||
| ENC005401 | ![]() |
0.341 | D02DGU | ![]() |
0.176 | ||
| ENC004633 | ![]() |
0.287 | D0G3PI | ![]() |
0.176 | ||
| ENC005951 | ![]() |
0.284 | D00DKK | ![]() |
0.176 | ||