![]() |
Name |
(Z)-6-[(2S,5S)-5-(1-hydroxyethyl)-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid
|
Molecular Formula | C16H28O4 | |
IUPAC Name* |
(Z)-6-[(2S,5S)-5-(1-hydroxyethyl)-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid
|
|
SMILES |
CC(CC(C)C(=O)O)/C=C(/C)\[C@@H]1CC[C@@](O1)(C)C(C)O
|
|
InChI |
InChI=1S/C16H28O4/c1-10(9-12(3)15(18)19)8-11(2)14-6-7-16(5,20-14)13(4)17/h8,10,12-14,17H,6-7,9H2,1-5H3,(H,18,19)/b11-8-/t10?,12?,13?,14-,16-/m0/s1
|
|
InChIKey |
BVFQDPRIMUDOQZ-FMZUCOQQSA-N
|
|
Synonyms |
Asperic acid
|
|
CAS | NA | |
PubChem CID | 101006397 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.39 | ALogp: | 2.8 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.728 |
Caco-2 Permeability: | -4.709 | MDCK Permeability: | 0.00002790 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.231 |
Human Intestinal Absorption (HIA): | 0.035 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.799 |
Blood-Brain-Barrier Penetration (BBB): | 0.396 | Plasma Protein Binding (PPB): | 68.93% |
Volume Distribution (VD): | 0.74 | Fu: | 10.71% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.262 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.868 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.504 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.299 |
CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.175 |
Clearance (CL): | 11.383 | Half-life (T1/2): | 0.732 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.566 |
Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.123 | Maximum Recommended Daily Dose: | 0.024 |
Skin Sensitization: | 0.436 | Carcinogencity: | 0.173 |
Eye Corrosion: | 0.04 | Eye Irritation: | 0.113 |
Respiratory Toxicity: | 0.304 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005742 | ![]() |
0.290 | D0I0EG | ![]() |
0.203 | ||
ENC002417 | ![]() |
0.286 | D08QGD | ![]() |
0.200 | ||
ENC005680 | ![]() |
0.279 | D01CKY | ![]() |
0.198 | ||
ENC005679 | ![]() |
0.278 | D08SVH | ![]() |
0.196 | ||
ENC002937 | ![]() |
0.270 | D0R1QE | ![]() |
0.195 | ||
ENC002278 | ![]() |
0.269 | D00WUF | ![]() |
0.194 | ||
ENC002451 | ![]() |
0.261 | D02DGU | ![]() |
0.194 | ||
ENC005743 | ![]() |
0.260 | D00DKK | ![]() |
0.194 | ||
ENC006057 | ![]() |
0.256 | D0RA5Q | ![]() |
0.194 | ||
ENC006058 | ![]() |
0.256 | D0G3PI | ![]() |
0.194 |