![]() |
Name |
3,3a,5,6,9,9a-Hexahydro-1-(1,5-dimethyl-4,5-dihydroxyhexyl)-3a-methyl-5-hydroxycyclopenta[b][1]benzopyran-8(7H)-one
|
Molecular Formula | C21H32O5 | |
IUPAC Name* |
1-(5,6-dihydroxy-6-methylheptan-2-yl)-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one
|
|
SMILES |
CC(CCC(C(C)(C)O)O)C1=CCC2(C1CC3=C(O2)C(CCC3=O)O)C
|
|
InChI |
InChI=1S/C21H32O5/c1-12(5-8-18(24)20(2,3)25)13-9-10-21(4)15(13)11-14-16(22)6-7-17(23)19(14)26-21/h9,12,15,17-18,23-25H,5-8,10-11H2,1-4H3
|
|
InChIKey |
JTDRYGZNULUXEU-UHFFFAOYSA-N
|
|
Synonyms |
Tricycloalternarene 6a; 3,3a,5,6,9,9a-Hexahydro-1-(1,5-dimethyl-4,5-dihydroxyhexyl)-3a-methyl-5-hydroxycyclopenta[b][1]benzopyran-8(7H)-one
|
|
CAS | NA | |
PubChem CID | 100943921 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 364.5 | ALogp: | 0.9 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.651 |
Caco-2 Permeability: | -4.566 | MDCK Permeability: | 0.00002080 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.25 | 20% Bioavailability (F20%): | 0.942 |
30% Bioavailability (F30%): | 0.021 |
Blood-Brain-Barrier Penetration (BBB): | 0.828 | Plasma Protein Binding (PPB): | 61.43% |
Volume Distribution (VD): | 1.227 | Fu: | 27.00% |
CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.174 |
CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.669 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.209 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.31 |
CYP3A4-inhibitor: | 0.059 | CYP3A4-substrate: | 0.253 |
Clearance (CL): | 13.689 | Half-life (T1/2): | 0.593 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.294 |
Drug-inuced Liver Injury (DILI): | 0.303 | AMES Toxicity: | 0.023 |
Rat Oral Acute Toxicity: | 0.912 | Maximum Recommended Daily Dose: | 0.563 |
Skin Sensitization: | 0.019 | Carcinogencity: | 0.934 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.213 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003124 | ![]() |
0.795 | D02ZGI | ![]() |
0.357 | ||
ENC003211 | ![]() |
0.695 | D0T2PL | ![]() |
0.277 | ||
ENC001869 | ![]() |
0.655 | D05BTM | ![]() |
0.267 | ||
ENC005807 | ![]() |
0.635 | D08SVH | ![]() |
0.267 | ||
ENC003212 | ![]() |
0.544 | D02VPX | ![]() |
0.261 | ||
ENC001868 | ![]() |
0.511 | D0L7AS | ![]() |
0.252 | ||
ENC005805 | ![]() |
0.511 | D0N1TP | ![]() |
0.246 | ||
ENC003577 | ![]() |
0.500 | D0K5WS | ![]() |
0.233 | ||
ENC005806 | ![]() |
0.500 | D04VIS | ![]() |
0.221 | ||
ENC004443 | ![]() |
0.495 | D04ATM | ![]() |
0.219 |