![]() |
Name |
8-Methoxynaphthalene-1,7-diol
|
Molecular Formula | C11H10O3 | |
IUPAC Name* |
8-methoxynaphthalene-1,7-diol
|
|
SMILES |
COC1=C(C=CC2=C1C(=CC=C2)O)O
|
|
InChI |
InChI=1S/C11H10O3/c1-14-11-9(13)6-5-7-3-2-4-8(12)10(7)11/h2-6,12-13H,1H3
|
|
InChIKey |
MXKCIJHLIAYIAO-UHFFFAOYSA-N
|
|
Synonyms |
8-methoxynaphthalene-1,7-diol
|
|
CAS | NA | |
PubChem CID | 86279732 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 190.19 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.726 |
Caco-2 Permeability: | -4.77 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.023 |
Blood-Brain-Barrier Penetration (BBB): | 0.227 | Plasma Protein Binding (PPB): | 95.30% |
Volume Distribution (VD): | 0.509 | Fu: | 5.05% |
CYP1A2-inhibitor: | 0.986 | CYP1A2-substrate: | 0.889 |
CYP2C19-inhibitor: | 0.413 | CYP2C19-substrate: | 0.174 |
CYP2C9-inhibitor: | 0.492 | CYP2C9-substrate: | 0.914 |
CYP2D6-inhibitor: | 0.756 | CYP2D6-substrate: | 0.865 |
CYP3A4-inhibitor: | 0.442 | CYP3A4-substrate: | 0.243 |
Clearance (CL): | 13.855 | Half-life (T1/2): | 0.81 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.017 |
Drug-inuced Liver Injury (DILI): | 0.374 | AMES Toxicity: | 0.697 |
Rat Oral Acute Toxicity: | 0.457 | Maximum Recommended Daily Dose: | 0.039 |
Skin Sensitization: | 0.938 | Carcinogencity: | 0.84 |
Eye Corrosion: | 0.317 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.438 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000683 | ![]() |
0.587 | D08SKH | ![]() |
0.328 | ||
ENC002077 | ![]() |
0.583 | D0H6QU | ![]() |
0.315 | ||
ENC004659 | ![]() |
0.528 | D0DJ1B | ![]() |
0.303 | ||
ENC004820 | ![]() |
0.435 | D03UOT | ![]() |
0.298 | ||
ENC002284 | ![]() |
0.426 | D0U0OT | ![]() |
0.295 | ||
ENC004886 | ![]() |
0.426 | D0U3YB | ![]() |
0.286 | ||
ENC001512 | ![]() |
0.411 | D06GCK | ![]() |
0.286 | ||
ENC000404 | ![]() |
0.400 | D07MGA | ![]() |
0.282 | ||
ENC002351 | ![]() |
0.395 | D05CKR | ![]() |
0.279 | ||
ENC001961 | ![]() |
0.391 | D0J7RK | ![]() |
0.278 |