|
Name |
(3S,3aR,4S,6S,6aR,7E,10S,11E,13R,14S,15Z,17aR)-6,13,14-trihydroxy-3-(1H-indol-3-ylmethyl)-4,10,12-trimethyl-5-methylidene-3,3a,4,5,6,6a,9,10,13,14-decahydro-1H-cyclotrideca[d]isoindole-1,17(2H)-dione
|
| Molecular Formula | C32H38N2O5 | |
| IUPAC Name* |
(1R,3Z,5S,6R,7E,9S,11E,13R,14S,16S,17R,18S)-5,6,14-trihydroxy-18-(1H-indol-3-ylmethyl)-7,9,16-trimethyl-15-methylidene-19-azatricyclo[11.7.0.01,17]icosa-3,7,11-triene-2,20-dione
|
|
| SMILES |
C[C@H]\1C/C=C/[C@H]2[C@@H](C(=C)[C@H]([C@@H]3[C@@]2(C(=O)/C=C\[C@@H]([C@@H](/C(=C1)/C)O)O)C(=O)N[C@H]3CC4=CNC5=CC=CC=C54)C)O
|
|
| InChI |
InChI=1S/C32H38N2O5/c1-17-8-7-10-23-30(38)20(4)19(3)28-25(15-21-16-33-24-11-6-5-9-22(21)24)34-31(39)32(23,28)27(36)13-12-26(35)29(37)18(2)14-17/h5-7,9-14,16-17,19,23,25-26,28-30,33,35,37-38H,4,8,15H2,1-3H3,(H,34,39)/b10-7+,13-12-,18-14+/t17-,19+,23-,25-,26-,28-,29+,30+,32+/m0/s1
|
|
| InChIKey |
YUFTVRUFJJDEHE-DVBXYZRSSA-N
|
|
| Synonyms |
Cytoglobosin B; CHEBI:68815; Q27137193; (3S,3aR,4S,6S,6aR,7E,10S,11E,13R,14S,15Z,17aR)-6,13,14-trihydroxy-3-(1H-indol-3-ylmethyl)-4,10,12-trimethyl-5-methylidene-3,3a,4,5,6,6a,9,10,13,14-decahydro-1H-cyclotrideca[d]isoindole-1,17(2H)-dione
|
|
| CAS | NA | |
| PubChem CID | 71768062 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 530.7 | ALogp: | 2.6 |
| HBD: | 5 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 123.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 39 | QED Weighted: | 0.295 |
| Caco-2 Permeability: | -5.005 | MDCK Permeability: | 0.00001040 |
| Pgp-inhibitor: | 0.264 | Pgp-substrate: | 0.841 |
| Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.021 |
| 30% Bioavailability (F30%): | 0.004 |
| Blood-Brain-Barrier Penetration (BBB): | 0.653 | Plasma Protein Binding (PPB): | 92.37% |
| Volume Distribution (VD): | 0.411 | Fu: | 5.24% |
| CYP1A2-inhibitor: | 0.071 | CYP1A2-substrate: | 0.29 |
| CYP2C19-inhibitor: | 0.7 | CYP2C19-substrate: | 0.606 |
| CYP2C9-inhibitor: | 0.653 | CYP2C9-substrate: | 0.664 |
| CYP2D6-inhibitor: | 0.1 | CYP2D6-substrate: | 0.241 |
| CYP3A4-inhibitor: | 0.953 | CYP3A4-substrate: | 0.245 |
| Clearance (CL): | 8.175 | Half-life (T1/2): | 0.29 |
| hERG Blockers: | 0.139 | Human Hepatotoxicity (H-HT): | 0.519 |
| Drug-inuced Liver Injury (DILI): | 0.309 | AMES Toxicity: | 0.03 |
| Rat Oral Acute Toxicity: | 0.918 | Maximum Recommended Daily Dose: | 0.961 |
| Skin Sensitization: | 0.281 | Carcinogencity: | 0.225 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.978 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002440 | ![]() |
0.815 | D02DMQ | ![]() |
0.248 | ||
| ENC002682 | ![]() |
0.800 | D01TSI | ![]() |
0.242 | ||
| ENC002955 | ![]() |
0.785 | D0W7WC | ![]() |
0.240 | ||
| ENC002679 | ![]() |
0.783 | D05EJG | ![]() |
0.240 | ||
| ENC002681 | ![]() |
0.728 | D0BV3J | ![]() |
0.240 | ||
| ENC004447 | ![]() |
0.701 | D0SP3D | ![]() |
0.236 | ||
| ENC002120 | ![]() |
0.677 | D09NNH | ![]() |
0.236 | ||
| ENC002442 | ![]() |
0.662 | D0V3ZA | ![]() |
0.235 | ||
| ENC005215 | ![]() |
0.646 | D02XIY | ![]() |
0.223 | ||
| ENC004473 | ![]() |
0.644 | D00YLW | ![]() |
0.219 | ||