![]() |
Name |
Aflaquinolone A
|
Molecular Formula | C26H29NO5 | |
IUPAC Name* |
(3S,4S)-6-[(E)-2-[(1R,3S)-1,3-dimethyl-4-oxocyclohexyl]ethenyl]-4,5-dihydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one
|
|
SMILES |
C[C@H]1C[C@](CCC1=O)(C)/C=C/C2=C(C3=C(C=C2)NC(=O)[C@H]([C@@]3(C4=CC=CC=C4)O)OC)O
|
|
InChI |
InChI=1S/C26H29NO5/c1-16-15-25(2,14-12-20(16)28)13-11-17-9-10-19-21(22(17)29)26(31,18-7-5-4-6-8-18)23(32-3)24(30)27-19/h4-11,13,16,23,29,31H,12,14-15H2,1-3H3,(H,27,30)/b13-11+/t16-,23+,25+,26-/m0/s1
|
|
InChIKey |
QWVOGENNJWSIPL-KRLQRQCXSA-N
|
|
Synonyms |
Aflaquinolone A; CHEMBL2024580; 3beta-Methoxy-4beta,5-dihydroxy-4-phenyl-6-[2-(1,3alpha-dimethyl-4-oxocyclohexane-1beta-yl)vinyl]-3,4-dihydroquinoline-2(1H)-one
|
|
CAS | NA | |
PubChem CID | 57380849 | |
ChEMBL ID | CHEMBL2024580 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 435.5 | ALogp: | 3.0 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 95.9 | Aromatic Rings: | 4 |
Heavy Atoms: | 32 | QED Weighted: | 0.651 |
Caco-2 Permeability: | -4.667 | MDCK Permeability: | 0.00002690 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.201 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.592 | Plasma Protein Binding (PPB): | 95.93% |
Volume Distribution (VD): | 0.731 | Fu: | 2.53% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.889 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.88 |
CYP2C9-inhibitor: | 0.124 | CYP2C9-substrate: | 0.308 |
CYP2D6-inhibitor: | 0.08 | CYP2D6-substrate: | 0.106 |
CYP3A4-inhibitor: | 0.434 | CYP3A4-substrate: | 0.891 |
Clearance (CL): | 0.904 | Half-life (T1/2): | 0.422 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.544 |
Drug-inuced Liver Injury (DILI): | 0.366 | AMES Toxicity: | 0.357 |
Rat Oral Acute Toxicity: | 0.788 | Maximum Recommended Daily Dose: | 0.943 |
Skin Sensitization: | 0.605 | Carcinogencity: | 0.655 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.316 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002966 | ![]() |
0.679 | D0Z9NZ | ![]() |
0.301 | ||
ENC002967 | ![]() |
0.667 | D09LDR | ![]() |
0.292 | ||
ENC002968 | ![]() |
0.563 | D0P3JU | ![]() |
0.291 | ||
ENC002862 | ![]() |
0.526 | D0E0OG | ![]() |
0.276 | ||
ENC002969 | ![]() |
0.495 | D08EOD | ![]() |
0.275 | ||
ENC004649 | ![]() |
0.446 | D0E4DW | ![]() |
0.274 | ||
ENC002377 | ![]() |
0.431 | D0D7KC | ![]() |
0.266 | ||
ENC002863 | ![]() |
0.362 | D08UMH | ![]() |
0.266 | ||
ENC004520 | ![]() |
0.342 | D0T5WK | ![]() |
0.263 | ||
ENC004521 | ![]() |
0.342 | D0J5YC | ![]() |
0.262 |