|
Name |
L-Tenuazonic acid
|
| Molecular Formula | C10H15NO3 | |
| IUPAC Name* |
(2S)-4-acetyl-2-[(2S)-butan-2-yl]-3-hydroxy-1,2-dihydropyrrol-5-one
|
|
| SMILES |
CC[C@H](C)[C@H]1C(=C(C(=O)N1)C(=O)C)O
|
|
| InChI |
InChI=1S/C10H15NO3/c1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h5,8,13H,4H2,1-3H3,(H,11,14)/t5-,8-/m0/s1
|
|
| InChIKey |
CEIZFXOZIQNICU-XNCJUZBTSA-N
|
|
| Synonyms |
TENUAZONIC ACID; 610-88-8; 75652-74-3; L-Tenuazonic acid; TENUAZONIC ACID COPPER FROM ALTERNARIA A; CCRIS 6995; L-Tenuazonic acid[enol(chain)]; SCHEMBL20199961; HY-N6715; ZINC95671351; AKOS027263611; ZINC101116423; CS-0099761; Q286126; (3Z,5S)-5-[(2S)-BUTAN-2-YL]-3-(1-HYDROXYETHYLIDENE)PYRROLIDINE-2,4-DIONE; (5S)-3-acetyl-5-[(2S)-butan-2-yl]-4-hydroxy-2,5-dihydro-1H-pyrrol-2-one; 2,4-Pyrrolidinedione,3-(1-hydroxyethylidene)-5-[(1S)-1-methylpropyl]-, (3Z,5S)-; 2,4-Pyrrolidinedione,3-(1-hydroxyethylidene)-5-[(1S)-1-methylpropyl]-,(3Z,5S)-
|
|
| CAS | 610-88-8 | |
| PubChem CID | 54683011 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 197.23 | ALogp: | 1.2 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.4 | Aromatic Rings: | 1 |
| Heavy Atoms: | 14 | QED Weighted: | 0.671 |
| Caco-2 Permeability: | -4.696 | MDCK Permeability: | 0.00001090 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.011 |
| 30% Bioavailability (F30%): | 0.001 |
| Blood-Brain-Barrier Penetration (BBB): | 0.308 | Plasma Protein Binding (PPB): | 93.86% |
| Volume Distribution (VD): | 0.809 | Fu: | 5.35% |
| CYP1A2-inhibitor: | 0.819 | CYP1A2-substrate: | 0.936 |
| CYP2C19-inhibitor: | 0.09 | CYP2C19-substrate: | 0.085 |
| CYP2C9-inhibitor: | 0.449 | CYP2C9-substrate: | 0.653 |
| CYP2D6-inhibitor: | 0.45 | CYP2D6-substrate: | 0.261 |
| CYP3A4-inhibitor: | 0.215 | CYP3A4-substrate: | 0.293 |
| Clearance (CL): | 3.571 | Half-life (T1/2): | 0.788 |
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.157 |
| Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.875 | Maximum Recommended Daily Dose: | 0.04 |
| Skin Sensitization: | 0.25 | Carcinogencity: | 0.362 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.589 |
| Respiratory Toxicity: | 0.96 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005387 | ![]() |
1.000 | D0ZK8H | ![]() |
0.273 | ||
| ENC004092 | ![]() |
0.393 | D0A4JK | ![]() |
0.250 | ||
| ENC004973 | ![]() |
0.389 | D0R6BR | ![]() |
0.219 | ||
| ENC002815 | ![]() |
0.351 | D0W0MF | ![]() |
0.219 | ||
| ENC002566 | ![]() |
0.338 | D00MYT | ![]() |
0.219 | ||
| ENC005975 | ![]() |
0.328 | D0F0YZ | ![]() |
0.219 | ||
| ENC004972 | ![]() |
0.328 | D0Z1WA | ![]() |
0.208 | ||
| ENC002046 | ![]() |
0.314 | D05OQJ | ![]() |
0.207 | ||
| ENC002803 | ![]() |
0.300 | D0CT4D | ![]() |
0.206 | ||
| ENC004961 | ![]() |
0.281 | D0HD9K | ![]() |
0.202 | ||