|
Name |
Prenylcandidusin C
|
| Molecular Formula | C26H26O6 | |
| IUPAC Name* |
7-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-3,6,9-trimethoxydibenzofuran-2-ol
|
|
| SMILES |
CC(=CCC1=C(C=CC(=C1)C2=CC(=C3C4=CC(=C(C=C4OC3=C2OC)OC)O)OC)O)C
|
|
| InChI |
InChI=1S/C26H26O6/c1-14(2)6-7-16-10-15(8-9-19(16)27)17-12-23(30-4)24-18-11-20(28)22(29-3)13-21(18)32-26(24)25(17)31-5/h6,8-13,27-28H,7H2,1-5H3
|
|
| InChIKey |
HWBQSNYBSJLMIS-UHFFFAOYSA-N
|
|
| Synonyms |
Prenylcandidusin C; CHEBI:67532; CHEMBL1795463; DTXSID301315811; Q27136001; 7-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3,6,9-trimethoxydibenzo[b,d]furan-2-ol; 1297472-20-8
|
|
| CAS | 1297472-20-8 | |
| PubChem CID | 53354807 | |
| ChEMBL ID | CHEMBL1795463 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 434.5 | ALogp: | 6.4 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 81.3 | Aromatic Rings: | 4 |
| Heavy Atoms: | 32 | QED Weighted: | 0.351 |
| Caco-2 Permeability: | -5.001 | MDCK Permeability: | 0.00001550 |
| Pgp-inhibitor: | 0.701 | Pgp-substrate: | 0.025 |
| Human Intestinal Absorption (HIA): | 0.027 | 20% Bioavailability (F20%): | 0.007 |
| 30% Bioavailability (F30%): | 0.03 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 84.17% |
| Volume Distribution (VD): | 0.527 | Fu: | 20.03% |
| CYP1A2-inhibitor: | 0.725 | CYP1A2-substrate: | 0.931 |
| CYP2C19-inhibitor: | 0.919 | CYP2C19-substrate: | 0.096 |
| CYP2C9-inhibitor: | 0.845 | CYP2C9-substrate: | 0.918 |
| CYP2D6-inhibitor: | 0.209 | CYP2D6-substrate: | 0.925 |
| CYP3A4-inhibitor: | 0.29 | CYP3A4-substrate: | 0.315 |
| Clearance (CL): | 11.372 | Half-life (T1/2): | 0.427 |
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.705 |
| Drug-inuced Liver Injury (DILI): | 0.949 | AMES Toxicity: | 0.473 |
| Rat Oral Acute Toxicity: | 0.107 | Maximum Recommended Daily Dose: | 0.838 |
| Skin Sensitization: | 0.674 | Carcinogencity: | 0.102 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.687 |
| Respiratory Toxicity: | 0.608 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002760 | ![]() |
0.847 | D06GCK | ![]() |
0.450 | ||
| ENC005879 | ![]() |
0.727 | D0Q0PR | ![]() |
0.333 | ||
| ENC002471 | ![]() |
0.624 | D0Y7TS | ![]() |
0.323 | ||
| ENC005880 | ![]() |
0.585 | D0NJ3V | ![]() |
0.311 | ||
| ENC002758 | ![]() |
0.582 | D09DHY | ![]() |
0.310 | ||
| ENC005867 | ![]() |
0.577 | D02LZB | ![]() |
0.302 | ||
| ENC002475 | ![]() |
0.573 | D04AIT | ![]() |
0.301 | ||
| ENC002853 | ![]() |
0.553 | D0A8FB | ![]() |
0.295 | ||
| ENC002776 | ![]() |
0.550 | D0K8KX | ![]() |
0.284 | ||
| ENC005868 | ![]() |
0.549 | D0V8HJ | ![]() |
0.284 | ||