|
Name |
(R)-7-Hydroxy-3-((S)-1-hydroxyethyl)-5-methoxy-3,4-dimethylisobenzofuran-1(3H)-one
|
| Molecular Formula | C13H16O5 | |
| IUPAC Name* |
(3R)-7-hydroxy-3-[(1S)-1-hydroxyethyl]-5-methoxy-3,4-dimethyl-2-benzofuran-1-one
|
|
| SMILES |
CC1=C(C=C(C2=C1[C@](OC2=O)(C)[C@H](C)O)O)OC
|
|
| InChI |
InChI=1S/C13H16O5/c1-6-9(17-4)5-8(15)10-11(6)13(3,7(2)14)18-12(10)16/h5,7,14-15H,1-4H3/t7-,13-/m0/s1
|
|
| InChIKey |
YKQYIQHWWYVPHK-CPFSXVBKSA-N
|
|
| Synonyms |
CHEBI:67766; (R)-7-Hydroxy-3-((S)-1-hydroxyethyl)-5-methoxy-3,4-dimethylisobenzofuran-1(3H)-one; CHEMBL1765567; Q27136244; 3,4-Dimethyl-5-methoxy-7-hydroxy-3beta-[(S)-1-hydroxyethyl]isobenzofuran-1(3H)-one
|
|
| CAS | NA | |
| PubChem CID | 52937687 | |
| ChEMBL ID | CHEMBL1765567 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 252.26 | ALogp: | 1.9 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 18 | QED Weighted: | 0.787 |
| Caco-2 Permeability: | -4.717 | MDCK Permeability: | 0.00001210 |
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.13 |
| Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.007 |
| 30% Bioavailability (F30%): | 0.011 |
| Blood-Brain-Barrier Penetration (BBB): | 0.947 | Plasma Protein Binding (PPB): | 78.24% |
| Volume Distribution (VD): | 1 | Fu: | 22.48% |
| CYP1A2-inhibitor: | 0.824 | CYP1A2-substrate: | 0.816 |
| CYP2C19-inhibitor: | 0.075 | CYP2C19-substrate: | 0.78 |
| CYP2C9-inhibitor: | 0.061 | CYP2C9-substrate: | 0.714 |
| CYP2D6-inhibitor: | 0.047 | CYP2D6-substrate: | 0.34 |
| CYP3A4-inhibitor: | 0.257 | CYP3A4-substrate: | 0.307 |
| Clearance (CL): | 9.947 | Half-life (T1/2): | 0.748 |
| hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.141 |
| Drug-inuced Liver Injury (DILI): | 0.236 | AMES Toxicity: | 0.167 |
| Rat Oral Acute Toxicity: | 0.17 | Maximum Recommended Daily Dose: | 0.265 |
| Skin Sensitization: | 0.463 | Carcinogencity: | 0.037 |
| Eye Corrosion: | 0.086 | Eye Irritation: | 0.733 |
| Respiratory Toxicity: | 0.43 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004296 | ![]() |
0.732 | D07MGA | ![]() |
0.271 | ||
| ENC004501 | ![]() |
0.563 | D0C1SF | ![]() |
0.258 | ||
| ENC004498 | ![]() |
0.533 | D06GCK | ![]() |
0.247 | ||
| ENC004500 | ![]() |
0.484 | D09GYT | ![]() |
0.243 | ||
| ENC004499 | ![]() |
0.484 | D0E9CD | ![]() |
0.242 | ||
| ENC005907 | ![]() |
0.439 | D0J4IX | ![]() |
0.239 | ||
| ENC005042 | ![]() |
0.429 | D0L5FY | ![]() |
0.235 | ||
| ENC005949 | ![]() |
0.419 | D05QDC | ![]() |
0.233 | ||
| ENC005950 | ![]() |
0.419 | D08CCE | ![]() |
0.230 | ||
| ENC005951 | ![]() |
0.419 | D06GIP | ![]() |
0.226 | ||