|
Name |
Abiesatrine J
|
| Molecular Formula | C30H46O4 | |
| IUPAC Name* |
(E,6R)-6-[(1S,4R,5R,8S,9S,12S,13R)-13-(2-carboxyethyl)-4,8-dimethyl-12-prop-1-en-2-yl-5-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]-2-methylhept-2-enoic acid
|
|
| SMILES |
C[C@H](CC/C=C(\C)/C(=O)O)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@H]([C@]3(C4)CCC(=O)O)C(=C)C)C)C
|
|
| InChI |
InChI=1S/C30H46O4/c1-19(2)22-10-11-24-28(6)14-12-23(20(3)8-7-9-21(4)26(33)34)27(28,5)16-17-30(24)18-29(22,30)15-13-25(31)32/h9,20,22-24H,1,7-8,10-18H2,2-6H3,(H,31,32)(H,33,34)/b21-9+/t20-,22+,23-,24+,27-,28+,29-,30+/m1/s1
|
|
| InChIKey |
NJFOSFIPGRXARF-YNPQANPXSA-N
|
|
| Synonyms |
Abiesatrine J; 39111-07-4; J3.589.947B; 3,4-Seco-5alpha-cycloartane-4(28),24-diene-3,26-dioic acid
|
|
| CAS | NA | |
| PubChem CID | 46242050 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 470.7 | ALogp: | 8.5 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 74.6 | Aromatic Rings: | 4 |
| Heavy Atoms: | 34 | QED Weighted: | 0.267 |
| Caco-2 Permeability: | -5.787 | MDCK Permeability: | 0.00000345 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.618 |
| Blood-Brain-Barrier Penetration (BBB): | 0.251 | Plasma Protein Binding (PPB): | 98.32% |
| Volume Distribution (VD): | 0.585 | Fu: | 3.78% |
| CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.323 |
| CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.549 |
| CYP2C9-inhibitor: | 0.073 | CYP2C9-substrate: | 0.892 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.156 |
| CYP3A4-inhibitor: | 0.267 | CYP3A4-substrate: | 0.075 |
| Clearance (CL): | 1.564 | Half-life (T1/2): | 0.472 |
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.537 |
| Drug-inuced Liver Injury (DILI): | 0.027 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.228 | Maximum Recommended Daily Dose: | 0.301 |
| Skin Sensitization: | 0.687 | Carcinogencity: | 0.458 |
| Eye Corrosion: | 0.074 | Eye Irritation: | 0.055 |
| Respiratory Toxicity: | 0.912 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001582 | ![]() |
0.399 | D0X7XG | ![]() |
0.317 | ||
| ENC002119 | ![]() |
0.373 | D0M4WA | ![]() |
0.308 | ||
| ENC001745 | ![]() |
0.347 | D0G3SH | ![]() |
0.300 | ||
| ENC005285 | ![]() |
0.336 | D03ZTE | ![]() |
0.300 | ||
| ENC005048 | ![]() |
0.331 | D0OR2L | ![]() |
0.286 | ||
| ENC002075 | ![]() |
0.328 | D00AEQ | ![]() |
0.281 | ||
| ENC005284 | ![]() |
0.326 | D08TEJ | ![]() |
0.255 | ||
| ENC001478 | ![]() |
0.317 | D0I2SD | ![]() |
0.250 | ||
| ENC005283 | ![]() |
0.307 | D05RXI | ![]() |
0.242 | ||
| ENC006069 | ![]() |
0.306 | D0Y7LD | ![]() |
0.241 | ||