|
Name |
Regiolone
|
| Molecular Formula | C10H10O3 | |
| IUPAC Name* |
(4R)-4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one
|
|
| SMILES |
C1CC(=O)C2=C([C@@H]1O)C=CC=C2O
|
|
| InChI |
InChI=1S/C10H10O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-3,7,11-12H,4-5H2/t7-/m1/s1
|
|
| InChIKey |
ZXYYTDCENDYKBR-SSDOTTSWSA-N
|
|
| Synonyms |
Regiolone; 137494-04-3; (4R)-4,8-Dihydroxy-3,4-dihydro-2H-naphthalen-1-one; (R)-(-)-Regiolone; Regiolone, (R)-(-)-; CP52QT43RP; 1(2H)-Naphthalenone, 3,4-dihydro-4,8-dihydroxy-, (R)-; (4R)-3,4-Dihydro-4,8-dihydroxy-1(2H)-naphthalenone; 1(2H)-Naphthalenone, 3,4-dihydro-4,8-dihydroxy-, (4R)-; (-)-isosclerone; (?)-Regiolone; UNII-CP52QT43RP; ISOSCLERONE, (R)-; CHEMBL482610; ZINC13460029; (4R)-4,8-Dihydroxy-alpha-tetralone; AKOS028109227; (4R)-4,8-DIHYDROXY-.ALPHA.-TETRALONE
|
|
| CAS | 137494-04-3 | |
| PubChem CID | 44576009 | |
| ChEMBL ID | CHEMBL482610 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 178.18 | ALogp: | 1.1 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
| Heavy Atoms: | 13 | QED Weighted: | 0.638 |
| Caco-2 Permeability: | -4.576 | MDCK Permeability: | 0.00001390 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.142 |
| Human Intestinal Absorption (HIA): | 0.147 | 20% Bioavailability (F20%): | 0.945 |
| 30% Bioavailability (F30%): | 0.993 |
| Blood-Brain-Barrier Penetration (BBB): | 0.436 | Plasma Protein Binding (PPB): | 32.46% |
| Volume Distribution (VD): | 0.823 | Fu: | 64.78% |
| CYP1A2-inhibitor: | 0.211 | CYP1A2-substrate: | 0.502 |
| CYP2C19-inhibitor: | 0.094 | CYP2C19-substrate: | 0.286 |
| CYP2C9-inhibitor: | 0.044 | CYP2C9-substrate: | 0.818 |
| CYP2D6-inhibitor: | 0.053 | CYP2D6-substrate: | 0.617 |
| CYP3A4-inhibitor: | 0.011 | CYP3A4-substrate: | 0.264 |
| Clearance (CL): | 8.312 | Half-life (T1/2): | 0.744 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.132 |
| Drug-inuced Liver Injury (DILI): | 0.145 | AMES Toxicity: | 0.477 |
| Rat Oral Acute Toxicity: | 0.366 | Maximum Recommended Daily Dose: | 0.29 |
| Skin Sensitization: | 0.435 | Carcinogencity: | 0.392 |
| Eye Corrosion: | 0.008 | Eye Irritation: | 0.797 |
| Respiratory Toxicity: | 0.263 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005241 | ![]() |
1.000 | D07HBX | ![]() |
0.286 | ||
| ENC005395 | ![]() |
1.000 | D0H6QU | ![]() |
0.274 | ||
| ENC004791 | ![]() |
1.000 | D0A3ZU | ![]() |
0.264 | ||
| ENC006050 | ![]() |
0.714 | D0R8PX | ![]() |
0.262 | ||
| ENC002458 | ![]() |
0.667 | D00ZFP | ![]() |
0.257 | ||
| ENC005720 | ![]() |
0.636 | D06OMW | ![]() |
0.254 | ||
| ENC004790 | ![]() |
0.574 | D0Q5NX | ![]() |
0.254 | ||
| ENC001083 | ![]() |
0.574 | D09OQV | ![]() |
0.250 | ||
| ENC005067 | ![]() |
0.574 | D01WJL | ![]() |
0.250 | ||
| ENC003360 | ![]() |
0.574 | D04QZD | ![]() |
0.250 | ||